The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
MePhe-MeGly-MeGly-Gly-Gly-MePhe-NH2 ID: ALA237414
PubChem CID: 23730955
Max Phase: Preclinical
Molecular Formula: C30H41N7O6
Molecular Weight: 595.70
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H](Cc1ccccc1)C(=O)N(C)CC(=O)N(C)CC(=O)NCC(=O)NCC(=O)N(C)[C@@H](Cc1ccccc1)C(N)=O
Standard InChI: InChI=1S/C30H41N7O6/c1-32-23(15-21-11-7-5-8-12-21)30(43)36(3)20-28(41)35(2)19-26(39)33-17-25(38)34-18-27(40)37(4)24(29(31)42)16-22-13-9-6-10-14-22/h5-14,23-24,32H,15-20H2,1-4H3,(H2,31,42)(H,33,39)(H,34,38)/t23-,24-/m0/s1
Standard InChI Key: DMVGHORYUZJPPS-ZEQRLZLVSA-N
Molfile:
RDKit 2D
43 44 0 0 1 0 0 0 0 0999 V2000
7.8833 -21.1875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5978 -20.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3123 -21.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0267 -20.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3123 -22.0125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1689 -20.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7412 -21.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4557 -20.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5978 -19.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8833 -19.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8861 -18.7114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1725 -18.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4570 -18.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4597 -19.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1739 -19.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1702 -21.1875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4557 -19.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8846 -20.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5991 -21.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5991 -22.0125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3136 -20.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0280 -21.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7425 -20.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4570 -21.1875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7425 -19.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1715 -20.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8859 -21.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8859 -22.0125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6004 -20.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3149 -21.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6004 -19.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3149 -22.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0293 -20.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7438 -21.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7389 -22.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4525 -22.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1680 -22.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1653 -21.1842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4511 -20.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6004 -22.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0293 -22.4250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0267 -19.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1702 -22.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 11 2 0
21 22 1 0
1 6 1 0
22 23 1 0
11 12 1 0
23 24 1 0
1 2 1 0
23 25 2 0
12 13 2 0
24 26 1 0
4 7 1 0
26 27 1 0
13 14 1 0
27 28 2 0
3 4 1 0
27 29 1 0
14 15 2 0
29 30 1 0
15 10 1 0
29 31 1 0
7 8 1 0
30 32 1 0
8 16 1 0
30 33 1 1
33 34 1 0
8 17 2 0
34 35 2 0
2 9 1 1
35 36 1 0
16 18 1 0
36 37 2 0
3 5 2 0
37 38 1 0
18 19 1 0
38 39 2 0
39 34 1 0
9 10 1 0
32 40 2 0
19 20 2 0
32 41 1 0
2 3 1 0
4 42 1 0
19 21 1 0
16 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.70Molecular Weight (Monoisotopic): 595.3118AlogP: -1.48#Rotatable Bonds: 16Polar Surface Area: 174.25Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.26CX Basic pKa: 8.37CX LogP: -1.93CX LogD: -2.94Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.18Np Likeness Score: -0.61
References 1. Hess S, Ovadia O, Shalev DE, Senderovich H, Qadri B, Yehezkel T, Salitra Y, Sheynis T, Jelinek R, Gilon C, Hoffman A.. (2007) Effect of structural and conformation modifications, including backbone cyclization, of hydrophilic hexapeptides on their intestinal permeability and enzymatic stability., 50 (24): [PMID:17983214 ] [10.1021/jm070836d ]