The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID46501215 ID: ALA2374166
PubChem CID: 90662030
Max Phase: Preclinical
Molecular Formula: C26H37NO5
Molecular Weight: 443.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1[C@@H](OC(C)=O)[C@]23C[C@@H]1[C@@H](OC(C)=O)CC2[C@]12C4C[C@H]3[C@@H]1N(CC)C[C@]4(C)CC[C@@H]2O
Standard InChI: InChI=1S/C26H37NO5/c1-6-27-12-24(5)8-7-21(30)26-19(24)9-17(22(26)27)25-11-16(13(2)23(25)32-15(4)29)18(10-20(25)26)31-14(3)28/h16-23,30H,2,6-12H2,1,3-5H3/t16-,17-,18-,19?,20?,21-,22-,23+,24-,25-,26-/m0/s1
Standard InChI Key: LBTGOQKCUJMQQK-QBBARXANSA-N
Molfile:
RDKit 2D
35 40 0 0 1 0 0 0 0 0999 V2000
1.8672 -1.0350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6689 -0.0549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6211 2.3394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1205 -0.3487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3911 3.5431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6215 -0.9228 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1800 -0.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5334 -0.2356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3499 0.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4739 -1.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0076 -1.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9425 -0.1733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7499 0.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4710 -0.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0180 -1.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8546 0.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8915 0.4506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2786 1.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1723 1.1110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8767 0.4525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1466 0.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5836 1.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8528 0.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3558 1.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5307 1.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1182 -1.0455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6930 0.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6920 -1.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3536 2.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2318 -1.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0882 -1.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0485 2.2744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8016 1.6958 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4459 -1.7350 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6009 -2.0948 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14 1 1 1
1 28 1 0
16 2 1 1
22 3 1 6
3 29 1 0
4 28 2 0
5 29 2 0
10 6 1 0
6 21 1 0
6 26 1 0
7 9 1 6
7 10 1 0
7 12 1 0
7 16 1 0
8 9 1 0
11 8 1 0
8 14 1 0
8 17 1 6
9 19 1 0
10 11 1 0
11 15 1 0
13 12 1 0
12 15 1 0
13 21 1 0
13 23 1 0
13 25 1 6
14 20 1 0
16 24 1 0
18 17 1 0
18 20 1 0
18 22 1 0
19 22 1 0
20 27 2 0
23 24 1 0
26 30 1 0
28 31 1 0
29 32 1 0
18 33 1 1
11 34 1 1
10 35 1 1
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.58Molecular Weight (Monoisotopic): 443.2672AlogP: 2.93#Rotatable Bonds: 3Polar Surface Area: 76.07Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.22CX LogP: 1.41CX LogD: -1.32Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: 3.45
References 1. PubChem BioAssay data set,