SID46501215

ID: ALA2374166

PubChem CID: 90662030

Max Phase: Preclinical

Molecular Formula: C26H37NO5

Molecular Weight: 443.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C1[C@@H](OC(C)=O)[C@]23C[C@@H]1[C@@H](OC(C)=O)CC2[C@]12C4C[C@H]3[C@@H]1N(CC)C[C@]4(C)CC[C@@H]2O

Standard InChI:  InChI=1S/C26H37NO5/c1-6-27-12-24(5)8-7-21(30)26-19(24)9-17(22(26)27)25-11-16(13(2)23(25)32-15(4)29)18(10-20(25)26)31-14(3)28/h16-23,30H,2,6-12H2,1,3-5H3/t16-,17-,18-,19?,20?,21-,22-,23+,24-,25-,26-/m0/s1

Standard InChI Key:  LBTGOQKCUJMQQK-QBBARXANSA-N

Molfile:  

     RDKit          2D

 35 40  0  0  1  0  0  0  0  0999 V2000
    1.8672   -1.0350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6689   -0.0549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6211    2.3394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1205   -0.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3911    3.5431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6215   -0.9228    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1800   -0.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5334   -0.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3499    0.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4739   -1.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0076   -1.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9425   -0.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7499    0.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4710   -0.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0180   -1.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8546    0.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8915    0.4506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2786    1.0578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1723    1.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8767    0.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1466    0.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5836    1.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8528    0.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3558    1.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5307    1.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1182   -1.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6930    0.5721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6920   -1.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3536    2.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2318   -1.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0882   -1.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0485    2.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8016    1.6958    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4459   -1.7350    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6009   -2.0948    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
 14  1  1  1
  1 28  1  0
 16  2  1  1
 22  3  1  6
  3 29  1  0
  4 28  2  0
  5 29  2  0
 10  6  1  0
  6 21  1  0
  6 26  1  0
  7  9  1  6
  7 10  1  0
  7 12  1  0
  7 16  1  0
  8  9  1  0
 11  8  1  0
  8 14  1  0
  8 17  1  6
  9 19  1  0
 10 11  1  0
 11 15  1  0
 13 12  1  0
 12 15  1  0
 13 21  1  0
 13 23  1  0
 13 25  1  6
 14 20  1  0
 16 24  1  0
 18 17  1  0
 18 20  1  0
 18 22  1  0
 19 22  1  0
 20 27  2  0
 23 24  1  0
 26 30  1  0
 28 31  1  0
 29 32  1  0
 18 33  1  1
 11 34  1  1
 10 35  1  1
M  END

Associated Targets(Human)

ATXN2 Tbio Ataxin-2 (54410 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GLP1R Tclin Glucagon-like peptide 1 receptor (111429 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.58Molecular Weight (Monoisotopic): 443.2672AlogP: 2.93#Rotatable Bonds: 3
Polar Surface Area: 76.07Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.22CX LogP: 1.41CX LogD: -1.32
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: 3.45

References

1. PubChem BioAssay data set, 

Source

Source(1):