The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-oleana-2,12-dien-28-amide ID: ALA2376091
PubChem CID: 72197088
Max Phase: Preclinical
Molecular Formula: C36H58BNO3
Molecular Weight: 563.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC[C@]2(C(N)=O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC=C(B6OC(C)(C)C(C)(C)O6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1
Standard InChI: InChI=1S/C36H58BNO3/c1-29(2)18-20-36(28(38)39)21-19-34(10)23(24(36)22-29)12-13-26-33(9)16-15-27(37-40-31(5,6)32(7,8)41-37)30(3,4)25(33)14-17-35(26,34)11/h12,15,24-26H,13-14,16-22H2,1-11H3,(H2,38,39)/t24-,25-,26+,33-,34+,35+,36-/m0/s1
Standard InChI Key: GKKVVJURUFQBCM-XZIFEFBKSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
22.7864 -4.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5789 -4.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0004 -3.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9833 -5.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9875 -5.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2777 -5.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1135 -2.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1176 -1.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4077 -2.9056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9962 -2.9056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5291 -1.6922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8234 -1.2794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7020 -2.4970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9962 -3.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2904 -4.1272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4118 -1.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2349 -2.0966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8192 -2.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3995 -3.7228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6937 -1.6757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5291 -2.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2946 -2.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7020 -4.1314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2349 -1.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8234 -0.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5847 -3.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5374 -0.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2307 -2.9180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5847 -2.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2431 -0.4664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1052 -3.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9406 -1.6880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3995 -2.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9879 -2.0843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6867 -4.8371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8695 -4.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1205 0.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9377 0.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6937 -3.3142 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.9879 -4.5358 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
29.8192 -2.0884 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.8767 -4.1268 0.0000 B 0 0 0 0 0 0 0 0 0 0 0 0
24.1284 -3.7926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7888 -4.9380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
8 7 1 0
9 7 1 0
10 13 1 0
11 21 1 0
12 8 1 0
13 9 1 0
14 23 1 0
15 14 1 0
16 8 2 0
11 17 1 1
18 7 1 0
19 9 1 0
20 13 1 0
21 18 1 0
22 10 1 0
23 19 1 0
24 11 1 0
25 12 1 0
26 15 1 0
27 25 1 0
28 17 2 0
29 22 1 0
30 24 1 0
7 31 1 6
32 17 1 0
9 33 1 1
10 34 1 1
35 15 1 0
36 15 1 0
37 27 1 0
38 27 1 0
13 39 1 6
14 40 1 6
12 41 1 1
11 12 1 0
20 16 1 0
14 10 1 0
27 30 1 0
26 29 2 0
26 42 1 0
42 43 1 0
43 2 1 0
2 5 1 0
5 44 1 0
44 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.68Molecular Weight (Monoisotopic): 563.4510AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Moreira VM, Salvador JA, Simões S, Destro F, Gavioli R.. (2013) Novel oleanolic vinyl boronates: synthesis and antitumor activity., 63 [PMID:23455056 ] [10.1016/j.ejmech.2013.01.040 ]