The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(5-(2-chlorophenylamino)-1H-indazol-1-yl)-N-(2-morpholinoethyl)benzamide ID: ALA2376915
PubChem CID: 71602723
Max Phase: Preclinical
Molecular Formula: C26H26ClN5O2
Molecular Weight: 475.98
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCN1CCOCC1)c1cccc(-n2ncc3cc(Nc4ccccc4Cl)ccc32)c1
Standard InChI: InChI=1S/C26H26ClN5O2/c27-23-6-1-2-7-24(23)30-21-8-9-25-20(16-21)18-29-32(25)22-5-3-4-19(17-22)26(33)28-10-11-31-12-14-34-15-13-31/h1-9,16-18,30H,10-15H2,(H,28,33)
Standard InChI Key: CUFBUESSXCZHQS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
10.4993 -8.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2195 -6.8947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9819 -7.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7393 -8.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5226 -7.5564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3087 -5.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5277 -5.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5280 -6.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3916 -6.9818 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.3093 -6.8315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8190 -6.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7067 -7.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8531 -6.9227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9752 -5.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1047 -5.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1618 -7.5782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8172 -5.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7902 -6.1638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6809 -5.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2609 -6.5784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4527 -6.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6301 -6.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6144 -7.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3950 -5.3473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2607 -5.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6784 -8.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9193 -8.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1058 -6.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1410 -8.9974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4003 -6.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9780 -6.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4308 -7.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2800 -8.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6872 -6.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25 20 2 0
32 13 1 0
12 33 2 0
15 28 2 0
17 15 1 0
23 32 1 0
34 19 1 0
1 27 1 0
28 11 1 0
20 31 1 0
7 8 1 0
27 4 1 0
24 19 1 0
13 21 1 0
21 22 1 0
2 23 1 0
16 3 1 0
7 17 2 0
10 12 1 0
6 7 1 0
31 34 2 0
26 1 2 0
2 22 1 0
4 16 1 0
27 5 2 0
30 2 1 0
5 12 1 0
4 29 2 0
8 10 1 0
34 9 1 0
15 24 1 0
33 26 1 0
14 25 1 0
11 8 2 0
18 6 2 0
3 30 1 0
19 14 2 0
10 18 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.98Molecular Weight (Monoisotopic): 475.1775AlogP: 4.48#Rotatable Bonds: 7Polar Surface Area: 71.42Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.03CX LogP: 4.00CX LogD: 3.98Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -2.17
References 1. Jiang R, Frackowiak B, Shin Y, Song X, Chen W, Lin L, Cameron MD, Duckett DR, Kamenecka TM.. (2013) Design and synthesis of 1-aryl-5-anilinoindazoles as c-Jun N-terminal kinase inhibitors., 23 (9): [PMID:23518277 ] [10.1016/j.bmcl.2013.02.082 ]