trans-2-(N-(5-chloro-2-methoxyphenyl)phenylsulfonamido)-N-(4-(2-oxo-2,3-dihydro-1H-benzo[d]imidazol-1-yl)cyclohexyl)acetamide

ID: ALA2381947

PubChem CID: 73356483

Max Phase: Preclinical

Molecular Formula: C28H29ClN4O5S

Molecular Weight: 569.08

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(Cl)cc1N(CC(=O)N[C@H]1CC[C@H](n2c(=O)[nH]c3ccccc32)CC1)S(=O)(=O)c1ccccc1

Standard InChI:  InChI=1S/C28H29ClN4O5S/c1-38-26-16-11-19(29)17-25(26)32(39(36,37)22-7-3-2-4-8-22)18-27(34)30-20-12-14-21(15-13-20)33-24-10-6-5-9-23(24)31-28(33)35/h2-11,16-17,20-21H,12-15,18H2,1H3,(H,30,34)(H,31,35)/t20-,21-

Standard InChI Key:  DGMXWRVMCVATCV-MEMLXQNLSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    2.1230  -19.3405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3399  -18.5438    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.5415  -18.7542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1053  -17.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9293  -17.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3405  -17.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9288  -16.4035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1016  -16.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6942  -17.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1675  -18.5451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5798  -19.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1642  -19.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5758  -20.6864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4026  -20.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8159  -19.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4019  -19.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6418  -19.9653    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.3384  -19.9685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9230  -20.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5813  -17.8305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4071  -17.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8209  -17.1168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8191  -18.5472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6450  -18.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0579  -19.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8801  -19.2672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2978  -18.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8870  -17.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0585  -17.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1236  -18.5585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3966  -18.1478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6124  -17.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3924  -18.9737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6076  -19.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4303  -20.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0368  -20.5774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8234  -20.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9971  -19.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3600  -17.1025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5  2  1  0
  2 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 15 17  1  0
 12 18  1  0
 18 19  1  0
 10 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 24 23  1  6
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  1
 30 34  1  0
 33 31  1  0
 31 32  1  0
 32 30  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 32 39  2  0
M  END

Associated Targets(Human)

TNKS2 Tchem Tankyrase 1/2 (384 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TNKS Tchem Tankyrase-1 (1241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 569.08Molecular Weight (Monoisotopic): 568.1547AlogP: 4.49#Rotatable Bonds: 8
Polar Surface Area: 113.50Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.86CX Basic pKa: CX LogP: 4.15CX LogD: 4.15
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -1.71

References

1. Bregman H, Chakka N, Guzman-Perez A, Gunaydin H, Gu Y, Huang X, Berry V, Liu J, Teffera Y, Huang L, Egge B, Mullady EL, Schneider S, Andrews PS, Mishra A, Newcomb J, Serafino R, Strathdee CA, Turci SM, Wilson C, DiMauro EF..  (2013)  Discovery of novel, induced-pocket binding oxazolidinones as potent, selective, and orally bioavailable tankyrase inhibitors.,  56  (11): [PMID:23701517] [10.1021/jm4000038]

Source