The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)pentyl 3-(4-chlorophenyl)propanoate ID: ALA2385316
PubChem CID: 71660198
Max Phase: Preclinical
Molecular Formula: C26H34ClNO4
Molecular Weight: 460.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)C(CCCCCOC(=O)CCc1ccc(Cl)cc1)N(C)CC2
Standard InChI: InChI=1S/C26H34ClNO4/c1-28-15-14-20-17-24(30-2)25(31-3)18-22(20)23(28)7-5-4-6-16-32-26(29)13-10-19-8-11-21(27)12-9-19/h8-9,11-12,17-18,23H,4-7,10,13-16H2,1-3H3
Standard InChI Key: SWUFKWKAEKPGPM-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
4.8982 -25.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8970 -26.1150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6118 -26.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6100 -24.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3254 -25.2840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3288 -26.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0480 -26.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7684 -26.1112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7650 -25.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0412 -24.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0503 -27.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3369 -27.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3392 -28.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6258 -29.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4840 -26.5217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1836 -24.8753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1834 -24.0503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1822 -26.5269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4681 -26.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6281 -29.8322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9147 -30.2467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1991 -29.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4858 -30.2506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1969 -29.0111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4898 -31.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7774 -31.4883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0612 -31.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3492 -31.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3528 -32.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0743 -32.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7833 -32.3102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6409 -32.7360 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 15 1 0
1 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
25 23 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.01Molecular Weight (Monoisotopic): 459.2176AlogP: 5.62#Rotatable Bonds: 11Polar Surface Area: 48.00Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.31CX LogP: 5.80CX LogD: 4.84Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: 0.31
References 1. Galán A, Moreno L, Párraga J, Serrano Á, Sanz MJ, Cortes D, Cabedo N.. (2013) Novel isoquinoline derivatives as antimicrobial agents., 21 (11): [PMID:23601815 ] [10.1016/j.bmc.2013.03.042 ]