The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)pentyl phenylcarbamate ID: ALA2385318
PubChem CID: 71660200
Max Phase: Preclinical
Molecular Formula: C24H32N2O4
Molecular Weight: 412.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)C(CCCCCOC(=O)Nc1ccccc1)N(C)CC2
Standard InChI: InChI=1S/C24H32N2O4/c1-26-14-13-18-16-22(28-2)23(29-3)17-20(18)21(26)12-8-5-9-15-30-24(27)25-19-10-6-4-7-11-19/h4,6-7,10-11,16-17,21H,5,8-9,12-15H2,1-3H3,(H,25,27)
Standard InChI Key: SOJCPVHJSUNSID-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
19.4232 -26.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4220 -26.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1368 -27.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1350 -25.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8504 -26.0048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8538 -26.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5730 -27.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2934 -26.8320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2900 -25.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5662 -25.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5753 -28.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8619 -28.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8642 -29.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1508 -29.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0090 -27.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7086 -25.5961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7084 -24.7711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7072 -27.2478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9931 -26.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1531 -30.5531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4397 -30.9675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7241 -30.5570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7219 -29.7320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0108 -30.9714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2952 -30.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2955 -29.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5807 -29.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8664 -29.7411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8713 -30.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5866 -30.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 15 1 0
1 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 412.53Molecular Weight (Monoisotopic): 412.2362AlogP: 5.04#Rotatable Bonds: 9Polar Surface Area: 60.03Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.05CX Basic pKa: 8.31CX LogP: 4.82CX LogD: 3.86Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.58Np Likeness Score: 0.10
References 1. Galán A, Moreno L, Párraga J, Serrano Á, Sanz MJ, Cortes D, Cabedo N.. (2013) Novel isoquinoline derivatives as antimicrobial agents., 21 (11): [PMID:23601815 ] [10.1016/j.bmc.2013.03.042 ]