The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)pentyl 4-fluorophenylcarbamate ID: ALA2385319
PubChem CID: 71660201
Max Phase: Preclinical
Molecular Formula: C24H31FN2O4
Molecular Weight: 430.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)C(CCCCCOC(=O)Nc1ccc(F)cc1)N(C)CC2
Standard InChI: InChI=1S/C24H31FN2O4/c1-27-13-12-17-15-22(29-2)23(30-3)16-20(17)21(27)7-5-4-6-14-31-24(28)26-19-10-8-18(25)9-11-19/h8-11,15-16,21H,4-7,12-14H2,1-3H3,(H,26,28)
Standard InChI Key: SUVIMOKYOBOOOZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
4.8469 -1.9290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8457 -2.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5605 -3.1692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5587 -1.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2741 -1.9254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2775 -2.7584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9967 -3.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7171 -2.7525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7137 -1.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9899 -1.5036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9990 -3.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2856 -4.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2879 -5.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5745 -5.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4327 -3.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1323 -1.5167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1321 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1309 -3.1683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4168 -2.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5768 -6.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8634 -6.8880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1478 -6.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1456 -5.6525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4345 -6.8919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7189 -6.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7192 -5.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0044 -5.2472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2901 -5.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2950 -6.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0103 -6.8977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5727 -5.2521 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 15 1 0
1 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.52Molecular Weight (Monoisotopic): 430.2268AlogP: 5.18#Rotatable Bonds: 9Polar Surface Area: 60.03Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.17CX Basic pKa: 8.31CX LogP: 4.97CX LogD: 4.01Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.56Np Likeness Score: -0.16
References 1. Galán A, Moreno L, Párraga J, Serrano Á, Sanz MJ, Cortes D, Cabedo N.. (2013) Novel isoquinoline derivatives as antimicrobial agents., 21 (11): [PMID:23601815 ] [10.1016/j.bmc.2013.03.042 ]