The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)pentyl 4-methoxyphenylcarbamate ID: ALA2385321
PubChem CID: 71660229
Max Phase: Preclinical
Molecular Formula: C25H34N2O5
Molecular Weight: 442.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC(=O)OCCCCCC2c3cc(OC)c(OC)cc3CCN2C)cc1
Standard InChI: InChI=1S/C25H34N2O5/c1-27-14-13-18-16-23(30-3)24(31-4)17-21(18)22(27)8-6-5-7-15-32-25(28)26-19-9-11-20(29-2)12-10-19/h9-12,16-17,22H,5-8,13-15H2,1-4H3,(H,26,28)
Standard InChI Key: JCNCTIOJXWEAIO-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
21.2010 -1.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1999 -2.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9147 -3.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9129 -1.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6283 -1.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6317 -2.6751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3509 -3.0864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0712 -2.6692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.0678 -1.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3440 -1.4202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3531 -3.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6398 -4.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6420 -5.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9287 -5.5653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7868 -3.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4865 -1.4333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4863 -0.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4851 -3.0850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7709 -2.6719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9309 -6.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2176 -6.8047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5020 -6.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4997 -5.5692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7886 -6.8086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0730 -6.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0733 -5.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3586 -5.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6442 -5.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6492 -6.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3645 -6.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9281 -5.1687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2153 -5.5841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 15 1 0
1 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.56Molecular Weight (Monoisotopic): 442.2468AlogP: 5.05#Rotatable Bonds: 10Polar Surface Area: 69.26Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.30CX Basic pKa: 8.31CX LogP: 4.67CX LogD: 3.71Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: 0.07
References 1. Galán A, Moreno L, Párraga J, Serrano Á, Sanz MJ, Cortes D, Cabedo N.. (2013) Novel isoquinoline derivatives as antimicrobial agents., 21 (11): [PMID:23601815 ] [10.1016/j.bmc.2013.03.042 ]