The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)pentyl 4-fluorophenethylcarbamate ID: ALA2385323
PubChem CID: 71660231
Max Phase: Preclinical
Molecular Formula: C26H35FN2O4
Molecular Weight: 458.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)C(CCCCCOC(=O)NCCc1ccc(F)cc1)N(C)CC2
Standard InChI: InChI=1S/C26H35FN2O4/c1-29-15-13-20-17-24(31-2)25(32-3)18-22(20)23(29)7-5-4-6-16-33-26(30)28-14-12-19-8-10-21(27)11-9-19/h8-11,17-18,23H,4-7,12-16H2,1-3H3,(H,28,30)
Standard InChI Key: AYXOTNNHQWDVQC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
10.7302 -10.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7290 -10.9397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4439 -11.3526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4420 -9.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1574 -10.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1609 -10.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8800 -11.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6004 -10.9359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5970 -10.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8732 -9.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8823 -12.1781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1689 -12.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1712 -13.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4578 -13.8319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3160 -11.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0156 -9.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0154 -8.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0142 -11.3516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3001 -10.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4601 -14.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7467 -15.0714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0312 -14.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0289 -13.8358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3178 -15.0753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3200 -15.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6067 -16.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6089 -17.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8941 -17.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8960 -18.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6122 -18.7847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3279 -18.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3225 -17.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6155 -19.6097 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 15 1 0
1 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.57Molecular Weight (Monoisotopic): 458.2581AlogP: 4.90#Rotatable Bonds: 11Polar Surface Area: 60.03Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.31CX LogP: 4.96CX LogD: 4.00Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -0.01
References 1. Galán A, Moreno L, Párraga J, Serrano Á, Sanz MJ, Cortes D, Cabedo N.. (2013) Novel isoquinoline derivatives as antimicrobial agents., 21 (11): [PMID:23601815 ] [10.1016/j.bmc.2013.03.042 ]