The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolin-1-yl)pentyl 4-methoxyphenethylcarbamate ID: ALA2385325
PubChem CID: 71660290
Max Phase: Preclinical
Molecular Formula: C27H38N2O5
Molecular Weight: 470.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCNC(=O)OCCCCCC2c3cc(OC)c(OC)cc3CCN2C)cc1
Standard InChI: InChI=1S/C27H38N2O5/c1-29-16-14-21-18-25(32-3)26(33-4)19-23(21)24(29)8-6-5-7-17-34-27(30)28-15-13-20-9-11-22(31-2)12-10-20/h9-12,18-19,24H,5-8,13-17H2,1-4H3,(H,28,30)
Standard InChI Key: ZONPAYRDMIMXCO-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
23.0510 -9.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0499 -10.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7647 -10.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7629 -9.1037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4783 -9.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4817 -10.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2009 -10.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9212 -10.3400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9178 -9.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1940 -9.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2031 -11.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4898 -11.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4920 -12.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7787 -13.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6368 -10.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3365 -9.1042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3363 -8.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3351 -10.7558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6209 -10.3427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7809 -14.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0676 -14.4755 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3520 -14.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3497 -13.2400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6386 -14.4794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6409 -15.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9275 -15.7189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9298 -16.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2150 -16.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2169 -17.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9330 -18.1889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6487 -17.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6433 -16.9471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9363 -19.0139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2235 -19.4293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 15 1 0
1 16 1 0
16 17 1 0
2 18 1 0
18 19 1 0
14 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.61Molecular Weight (Monoisotopic): 470.2781AlogP: 4.77#Rotatable Bonds: 12Polar Surface Area: 69.26Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.31CX LogP: 4.66CX LogD: 3.70Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: 0.20
References 1. Galán A, Moreno L, Párraga J, Serrano Á, Sanz MJ, Cortes D, Cabedo N.. (2013) Novel isoquinoline derivatives as antimicrobial agents., 21 (11): [PMID:23601815 ] [10.1016/j.bmc.2013.03.042 ]