2',4',4-trihydroxyl-3'-methyl-6'-methoxyldihydrochalcone

ID: ALA2385402

PubChem CID: 71625781

Max Phase: Preclinical

Molecular Formula: C17H18O5

Molecular Weight: 302.33

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(O)c(C)c(O)c1C(=O)CCc1ccc(O)cc1

Standard InChI:  InChI=1S/C17H18O5/c1-10-14(20)9-15(22-2)16(17(10)21)13(19)8-5-11-3-6-12(18)7-4-11/h3-4,6-7,9,18,20-21H,5,8H2,1-2H3

Standard InChI Key:  GMWFZJUAFVHBCA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
    2.2194  -11.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2182  -12.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9330  -13.1190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6495  -12.7057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6465  -11.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9312  -11.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3595  -11.4600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3563  -10.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5034  -13.1181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5048  -11.4665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9328  -13.9440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3645  -13.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3658  -13.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0783  -12.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7934  -13.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5072  -12.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2210  -13.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9343  -12.7010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9335  -11.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2134  -11.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5030  -11.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6467  -11.4606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  2  9  1  0
  1 10  1  0
  3 11  1  0
  4 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
M  END

Associated Targets(non-human)

Prkaa2 AMP-activated protein kinase, alpha-2 subunit (93 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 302.33Molecular Weight (Monoisotopic): 302.1154AlogP: 2.94#Rotatable Bonds: 5
Polar Surface Area: 86.99Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.27CX Basic pKa: CX LogP: 3.90CX LogD: 3.85
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.74Np Likeness Score: 1.17

References

1. Guo H, Zhao H, Kanno Y, Li W, Mu Y, Kuang X, Inouye Y, Koike K, Jiang H, Bai H..  (2013)  A dihydrochalcone and several homoisoflavonoids from Polygonatum odoratum are activators of adenosine monophosphate-activated protein kinase.,  23  (11): [PMID:23639538] [10.1016/j.bmcl.2013.04.027]

Source