Nimonol

ID: ALA2386304

PubChem CID: 73356511

Max Phase: Preclinical

Molecular Formula: C28H36O5

Molecular Weight: 452.59

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@@H]1[C@H](O)[C@H]2C(C)(C)C(=O)C=C[C@]2(C)[C@H]2CC[C@]3(C)C(=CC[C@H]3c3ccoc3)[C@]12C

Standard InChI:  InChI=1S/C28H36O5/c1-16(29)33-24-22(31)23-25(2,3)21(30)10-13-27(23,5)20-9-12-26(4)18(17-11-14-32-15-17)7-8-19(26)28(20,24)6/h8,10-11,13-15,18,20,22-24,31H,7,9,12H2,1-6H3/t18-,20+,22+,23-,24+,26-,27+,28-/m0/s1

Standard InChI Key:  GDMYRVKWBYREMU-XMLHTYRRSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    1.8029   -3.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8029   -4.6368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5199   -5.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2328   -4.6368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2328   -3.8080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5199   -3.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9466   -3.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6618   -3.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6691   -2.1645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9476   -2.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3843   -2.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6526   -3.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1733   -2.3310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4334   -1.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1635   -3.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3784   -3.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3765   -1.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6567   -4.6445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0965   -5.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9212   -5.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0901   -5.0493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2248   -2.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9387   -4.2223    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9481   -5.0479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2246   -5.4485    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6537   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9464   -5.8634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3605   -5.0565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3555   -5.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0592   -6.2839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6469   -6.2753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2193   -1.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2258   -0.4794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4442   -0.2201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9574   -0.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  7  1  0
 11 16  1  0
 15 12  1  0
 12 13  1  0
 13 11  1  0
 13 14  1  6
 16 15  2  0
 11 17  1  6
  8 18  1  0
  3 19  1  0
  3 20  1  0
  2 21  2  0
  5 22  1  1
  4 24  1  0
  7 23  1  6
 18 24  1  0
  1  2  1  0
  4 25  1  6
  1  6  2  0
  8 26  1  1
  2  3  1  0
 24 27  1  6
  3  4  1  0
 18 28  1  6
  4  5  1  0
 28 29  1  0
  5  6  1  0
 29 30  2  0
  7  8  1  0
 29 31  1  0
 32 33  2  0
  7 10  1  0
  8 16  1  0
 11  9  1  0
  9 10  1  0
 14 32  1  0
 33 34  1  0
 34 35  1  0
 35 14  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA2386304

   NIMONOL

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 452.59

Molecular Weight (Monoisotopic): 452.2563

AlogP: 5.21

#Rotatable Bonds: 2

Polar Surface Area: 76.74

Molecular Species: NEUTRAL

HBA: 5

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 5

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 13.84

CX Basic pKa: ┄

CX LogP: 4.41

CX LogD: 4.41

Aromatic Rings: 1

Heavy Atoms: 33

QED Weighted: 0.49

Np Likeness Score: 3.61

References

1. Gopalakrishnan G, Pradeep Singh N, Kasinath V..  (2002)  Photooxygenation of Nimonol, a Tetranortriterpenoid from Azadirachta indica. A. Juss,  7  (2): [10.3390/70200112]

2. Suresh G, Gopalakrishnan G, Wesley SD, Pradeep Singh ND, Malathi R, Rajan SS..  (2002)  Insect antifeedant activity of tetranortriterpenoids from the Rutales. A perusal of structural relations.,  50  (16): [PMID:12137465] [10.1021/jf025534t]

3. Yuan CM, Tang GH, Zhang Y, Wang XY, Cao MM, Guo F, Li Y, Di YT, Li SL, Hua HM, He HP, Hao XJ..  (2013)  Bioactive limonoid and triterpenoid constituents of Turraea pubescens.,  76  (6): [PMID:23734701] [10.1021/np400276q]

4. Gualtieri MJ, Malafronte N, Vassallo A, Braca A, Cotugno R, Vasaturo M, De Tommasi N, Dal Piaz F..  (2014)  Bioactive limonoids from the leaves of Azaridachta indica (Neem).,  77  (3): [PMID:24499352] [10.1021/np400863d]

Source

Source(1):

• Scientific Literature