The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
sodium-(E)-5,5'-(((Diazene-1,2-diylbis(4,1-phenylene))bis-(methylene))bis(oxy))bis(4-oxo-4H-chromene-2-carboxylate) ID: ALA2386598
PubChem CID: 71682155
Max Phase: Preclinical
Molecular Formula: C34H20N2Na2O10
Molecular Weight: 618.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C([O-])c1cc(=O)c2c(OCc3ccc(/N=N/c4ccc(COc5cccc6oc(C(=O)[O-])cc(=O)c56)cc4)cc3)cccc2o1.[Na+].[Na+]
Standard InChI: InChI=1S/C34H22N2O10.2Na/c37-23-15-29(33(39)40)45-27-5-1-3-25(31(23)27)43-17-19-7-11-21(12-8-19)35-36-22-13-9-20(10-14-22)18-44-26-4-2-6-28-32(26)24(38)16-30(46-28)34(41)42;;/h1-16H,17-18H2,(H,39,40)(H,41,42);;/q;2*+1/p-2/b36-35+;;
Standard InChI Key: ULGPTBYSRMLAEZ-APVPWGIASA-L
Molfile:
RDKit 2D
48 51 0 0 0 0 0 0 0 0999 V2000
23.0153 -5.3131 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
21.8541 -8.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5680 -8.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2797 -8.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2754 -7.3823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8447 -7.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5564 -6.9770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5523 -6.1576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8384 -5.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1269 -6.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1293 -6.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4173 -7.4055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8338 -4.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5470 -4.5047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1178 -4.5096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4246 -8.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1407 -8.6339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0310 -14.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7493 -14.8159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4551 -14.3969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0184 -13.5851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7316 -13.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4475 -13.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1553 -13.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1483 -12.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4277 -11.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7229 -12.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3001 -13.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7590 -15.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0489 -16.0626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4780 -16.0473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0035 -11.9472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9938 -11.1221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4271 -11.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1428 -10.7025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1411 -9.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4250 -9.4665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7092 -9.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7143 -10.7081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8549 -9.4642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5703 -9.8753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2840 -9.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9958 -9.8768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7092 -9.4636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7080 -8.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9877 -8.2266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2772 -8.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7682 -16.6770 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 7 1 0
6 2 1 0
6 7 2 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
13 14 1 0
13 15 2 0
9 13 1 0
16 17 1 0
17 2 1 0
18 19 2 0
18 21 1 0
19 20 1 0
20 23 1 0
22 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
21 28 2 0
29 30 1 0
29 31 2 0
19 29 1 0
27 32 1 0
32 33 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
36 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 46 1 0
46 47 2 0
47 42 1 0
39 33 1 0
45 16 1 0
M CHG 4 1 1 14 -1 30 -1 48 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 618.55Molecular Weight (Monoisotopic): 618.1274AlogP: 6.87#Rotatable Bonds: 10Polar Surface Area: 178.20Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.57CX Basic pKa: 0.31CX LogP: 5.84CX LogD: -0.89Aromatic Rings: 6Heavy Atoms: 46QED Weighted: 0.15Np Likeness Score: -0.06
References 1. Velema WA, van der Toorn M, Szymanski W, Feringa BL.. (2013) Design, synthesis, and inhibitory activity of potent, photoswitchable mast cell activation inhibitors., 56 (11): [PMID:23617679 ] [10.1021/jm400115k ] 2. Velema WA, van der Toorn M, Szymanski W, Feringa BL.. (2013) Design, synthesis, and inhibitory activity of potent, photoswitchable mast cell activation inhibitors., 56 (11): [PMID:23617679 ] [10.1021/jm400115k ]