2-(5-methyl-1-(2-phenoxybenzyl)-3-phenyl-1H-pyrazol-4-yl)acetic acid

ID: ALA2387697

PubChem CID: 67607503

Max Phase: Preclinical

Molecular Formula: C25H22N2O3

Molecular Weight: 398.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(CC(=O)O)c(-c2ccccc2)nn1Cc1ccccc1Oc1ccccc1

Standard InChI:  InChI=1S/C25H22N2O3/c1-18-22(16-24(28)29)25(19-10-4-2-5-11-19)26-27(18)17-20-12-8-9-15-23(20)30-21-13-6-3-7-14-21/h2-15H,16-17H2,1H3,(H,28,29)

Standard InChI Key:  ZFCGJBJHJLQNTG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   15.3737  -16.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9530  -16.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3583  -17.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1777  -17.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5972  -16.9782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1971  -16.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1245  -16.9599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9072  -14.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4874  -15.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8939  -16.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7199  -16.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1377  -15.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7289  -14.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6240  -17.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4492  -17.8225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7058  -17.0384    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0367  -16.5515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3709  -17.0385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2193  -18.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6496  -16.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6360  -15.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3434  -15.3919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9145  -15.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0351  -15.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3933  -18.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9887  -19.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4090  -19.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2383  -19.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6392  -19.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5289  -16.9809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 14 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 17 24  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 19  1  0
 16 30  1  0
 30 10  1  0
 11  7  1  0
  7  2  1  0
M  END

Associated Targets(Human)

TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTGDR Tclin Prostanoid DP receptor (1356 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.46Molecular Weight (Monoisotopic): 398.1630AlogP: 5.33#Rotatable Bonds: 7
Polar Surface Area: 64.35Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.08CX Basic pKa: 2.29CX LogP: 5.38CX LogD: 2.38
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -1.04

References

1. Andrés M, Bravo M, Buil MA, Calbet M, Castro J, Domènech T, Eichhorn P, Ferrer M, Gómez E, Lehner MD, Moreno I, Roberts RS, Sevilla S..  (2013)  2-(1H-Pyrazol-4-yl)acetic acids as CRTh2 antagonists.,  23  (11): [PMID:23601708] [10.1016/j.bmcl.2013.03.093]

Source