2-(5-methyl-1-(2-(morpholinosulfonyl)benzyl)-3-phenyl-1H-pyrazol-4-yl)acetic acid

ID: ALA2387699

Cas Number: 1379445-54-1

PubChem CID: 67607161

Max Phase: Preclinical

Molecular Formula: C23H25N3O5S

Molecular Weight: 455.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(CC(=O)O)c(-c2ccccc2)nn1Cc1ccccc1S(=O)(=O)N1CCOCC1

Standard InChI:  InChI=1S/C23H25N3O5S/c1-17-20(15-22(27)28)23(18-7-3-2-4-8-18)24-26(17)16-19-9-5-6-10-21(19)32(29,30)25-11-13-31-14-12-25/h2-10H,11-16H2,1H3,(H,27,28)

Standard InChI Key:  NAFLVUYNUAWSOI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    6.9846  -20.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5639  -21.5206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9692  -22.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7885  -22.2463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2079  -21.5306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8079  -20.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7313  -22.3373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7355  -21.5122    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.0189  -21.9211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5183  -19.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0986  -20.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5050  -20.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3309  -20.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7487  -20.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3399  -19.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2354  -22.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0605  -22.3748    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3171  -21.5908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6480  -21.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9822  -21.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8307  -23.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2611  -21.1902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2475  -20.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9548  -19.9445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5199  -19.9680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6464  -20.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0048  -23.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5958  -23.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0205  -24.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8497  -24.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2506  -23.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1401  -21.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  1  1  0
  8  7  2  0
  9  8  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 16 21  1  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 19 26  1  0
 21 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 21  1  0
 18 32  1  0
 32 12  1  0
 13  8  1  0
  8  2  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

TBXA2R Tclin Thromboxane A2 receptor (5717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTGDR Tclin Prostanoid DP receptor (1356 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTGDR2 Tchem G protein-coupled receptor 44 (4688 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.54Molecular Weight (Monoisotopic): 455.1515AlogP: 2.55#Rotatable Bonds: 7
Polar Surface Area: 101.73Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.70CX Basic pKa: 2.28CX LogP: 2.66CX LogD: -0.49
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -1.66

References

1. Andrés M, Bravo M, Buil MA, Calbet M, Castro J, Domènech T, Eichhorn P, Ferrer M, Gómez E, Lehner MD, Moreno I, Roberts RS, Sevilla S..  (2013)  2-(1H-Pyrazol-4-yl)acetic acids as CRTh2 antagonists.,  23  (11): [PMID:23601708] [10.1016/j.bmcl.2013.03.093]

Source