The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-bis-[3,5-bis(benzylidene)-4-oxo-piperidin-1yl]propane ID: ALA2391222
PubChem CID: 73352019
Max Phase: Preclinical
Molecular Formula: C41H38N2O2
Molecular Weight: 590.77
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1/C(=C\c2ccccc2)CN(CCCN2C/C(=C\c3ccccc3)C(=O)/C(=C/c3ccccc3)C2)C/C1=C\c1ccccc1
Standard InChI: InChI=1S/C41H38N2O2/c44-40-36(24-32-14-5-1-6-15-32)28-42(29-37(40)25-33-16-7-2-8-17-33)22-13-23-43-30-38(26-34-18-9-3-10-19-34)41(45)39(31-43)27-35-20-11-4-12-21-35/h1-12,14-21,24-27H,13,22-23,28-31H2/b36-24-,37-25+,38-26+,39-27+
Standard InChI Key: GSYUJGOKPBKKJT-NOVHRWNDSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
14.7873 -11.0600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7850 -11.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4930 -12.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2032 -11.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2055 -11.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4975 -10.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9112 -12.2916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9123 -10.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6171 -11.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3214 -10.6425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0352 -11.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0447 -11.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3404 -12.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6266 -11.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4907 -13.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7736 -13.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0704 -13.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3576 -13.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3502 -14.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0534 -14.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7641 -14.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3934 -9.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4022 -8.5978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1156 -8.1969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1265 -7.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4240 -6.9612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7105 -7.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6996 -8.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4349 -6.1429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0080 -6.9448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2945 -7.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5920 -6.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8806 -7.3257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8697 -8.1440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5723 -8.5614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2857 -8.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8400 -6.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5465 -7.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5600 -8.1894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2748 -8.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9760 -8.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9624 -7.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2476 -6.9514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0965 -9.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0873 -10.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
4 7 2 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
5 8 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
3 15 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
23 28 1 0
26 29 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
31 36 2 0
27 30 2 0
37 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
38 43 2 0
25 37 2 0
22 23 1 0
22 44 1 0
44 45 1 0
45 1 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 590.77Molecular Weight (Monoisotopic): 590.2933AlogP: 7.48#Rotatable Bonds: 8Polar Surface Area: 40.62Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.43CX LogP: 8.45CX LogD: 8.45Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.20Np Likeness Score: -0.27
References 1. Das S, Das U, Michel D, Gorecki DK, Dimmock JR.. (2013) Novel 3,5-bis(arylidene)-4-piperidone dimers: potent cytotoxins against colon cancer cells., 64 [PMID:23644215 ] [10.1016/j.ejmech.2013.03.055 ] 2. Santiago-Vazquez Y, Das S, Das U, Robles-Escajeda E, Ortega NM, Lema C, Varela-Ramírez A, Aguilera RJ, Balzarini J, De Clercq E, Dimmock SG, Gorecki DK, Dimmock JR.. (2014) Novel 3,5-bis(arylidene)-4-oxo-1-piperidinyl dimers: structure-activity relationships and potent antileukemic and antilymphoma cytotoxicity., 77 [PMID:24657568 ] [10.1016/j.ejmech.2014.03.009 ]