The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-N1,N2-Diphenyl-2-(N-phenylundecanoylamido)isobutyramidine hydrochloride ID: ALA2392459
PubChem CID: 52997500
Max Phase: Preclinical
Molecular Formula: C33H44ClN3O
Molecular Weight: 497.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCC(=O)N(CC(C)/C(=N\c1ccccc1)Nc1ccccc1)c1ccccc1.Cl
Standard InChI: InChI=1S/C33H43N3O.ClH/c1-3-4-5-6-7-8-9-19-26-32(37)36(31-24-17-12-18-25-31)27-28(2)33(34-29-20-13-10-14-21-29)35-30-22-15-11-16-23-30;/h10-18,20-25,28H,3-9,19,26-27H2,1-2H3,(H,34,35);1H
Standard InChI Key: VRLFADVTNZGIDS-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
8.6993 -10.3970 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.5542 -10.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2687 -10.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9832 -10.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6976 -10.2875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9832 -11.5251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6976 -9.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6976 -11.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6931 -12.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4068 -13.1761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1222 -12.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1195 -11.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4053 -11.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4153 -9.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4156 -8.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7007 -7.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9838 -8.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9869 -9.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2687 -9.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8398 -10.2875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1252 -10.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4107 -10.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1252 -11.5251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8398 -9.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5576 -9.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5580 -8.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8430 -7.8162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1261 -8.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1292 -9.0561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6963 -10.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9818 -10.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2673 -10.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4529 -10.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1634 -10.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8822 -10.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5928 -10.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3117 -10.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0222 -10.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
5 7 1 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 7 1 0
3 19 1 0
2 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
20 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
22 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.73Molecular Weight (Monoisotopic): 497.3406AlogP: 9.03#Rotatable Bonds: 15Polar Surface Area: 44.70Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.54CX LogP: 9.09CX LogD: 8.72Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.13Np Likeness Score: -0.75
References 1. Korshin EE, Zakharova LG, Levin YA, Shulaeva MP, Pozdeev OK.. (2013) Anti-influenza active and low toxic N-phenyl-substituted β-amidoamidines structurally related to natural antibiotic amidinomycin., 23 (8): [PMID:23489622 ] [10.1016/j.bmcl.2013.02.053 ]