The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-N1,N2-Diphenyl-2-(N-phenyltridecanoylamido)isobutyramidine hydrochloride ID: ALA2392460
PubChem CID: 2728901
Max Phase: Preclinical
Molecular Formula: C35H48ClN3O
Molecular Weight: 525.78
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCC(=O)N(CC(C)/C(=N\c1ccccc1)Nc1ccccc1)c1ccccc1.Cl
Standard InChI: InChI=1S/C35H47N3O.ClH/c1-3-4-5-6-7-8-9-10-11-21-28-34(39)38(33-26-19-14-20-27-33)29-30(2)35(36-31-22-15-12-16-23-31)37-32-24-17-13-18-25-32;/h12-20,22-27,30H,3-11,21,28-29H2,1-2H3,(H,36,37);1H
Standard InChI Key: HABHGWZCAROGBH-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
23.7122 -10.4866 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.5167 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2312 -10.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9458 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6603 -10.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9458 -11.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6603 -9.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6603 -11.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6557 -12.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3694 -13.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0847 -12.7302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0821 -11.9009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3680 -11.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3778 -9.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3783 -8.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6632 -7.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9464 -8.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9495 -9.0224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2312 -9.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8023 -10.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0878 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3733 -10.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0878 -11.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8023 -9.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5202 -9.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5206 -8.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8055 -7.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0887 -8.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0919 -9.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6589 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9444 -10.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2299 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5155 -10.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8010 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0865 -10.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3721 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6575 -10.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9430 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2286 -10.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5141 -10.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
5 7 1 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 7 1 0
3 19 1 0
2 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
20 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
22 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 525.78Molecular Weight (Monoisotopic): 525.3719AlogP: 9.81#Rotatable Bonds: 17Polar Surface Area: 44.70Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.54CX LogP: 9.98CX LogD: 9.61Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: -0.71
References 1. Korshin EE, Zakharova LG, Levin YA, Shulaeva MP, Pozdeev OK.. (2013) Anti-influenza active and low toxic N-phenyl-substituted β-amidoamidines structurally related to natural antibiotic amidinomycin., 23 (8): [PMID:23489622 ] [10.1016/j.bmcl.2013.02.053 ]