3-[3-(Furan-3-yl)phenyl]-2-tert-butyl-6-(thien-3-yl)imidazo[1,2-b]pyridazine

ID: ALA2393002

PubChem CID: 71698358

Max Phase: Preclinical

Molecular Formula: C24H21N3OS

Molecular Weight: 399.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1nc2ccc(-c3ccsc3)nn2c1-c1cccc(-c2ccoc2)c1

Standard InChI:  InChI=1S/C24H21N3OS/c1-24(2,3)23-22(17-6-4-5-16(13-17)18-9-11-28-14-18)27-21(25-23)8-7-20(26-27)19-10-12-29-15-19/h4-15H,1-3H3

Standard InChI Key:  PWZZUVSUYNDPIW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    7.4489   -0.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4477   -1.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1626   -2.0027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1608   -0.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8762   -0.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8765   -1.5899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6669   -1.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1553   -1.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6665   -0.5019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9216   -2.6282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3681   -3.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6226   -4.0254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4305   -4.1973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9832   -3.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7257   -2.7975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7333   -1.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9799   -1.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4273   -2.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8393   -2.9905    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.6464   -2.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9803   -1.1738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3931   -1.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3926   -0.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8046   -1.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7870   -3.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1254   -4.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9456   -4.4089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1141   -3.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3980   -3.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 16  2  0
  2 16  1  0
  8 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 25  1  0
 14 25  1  0
M  END

Associated Targets(Human)

Huh-5-2 (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.52Molecular Weight (Monoisotopic): 399.1405AlogP: 6.68#Rotatable Bonds: 3
Polar Surface Area: 43.33Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.76CX LogP: 6.75CX LogD: 6.75
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.34Np Likeness Score: -1.49

References

1. Enguehard-Gueiffier C, Musiu S, Henry N, Véron JB, Mavel S, Neyts J, Leyssen P, Paeshuyse J, Gueiffier A..  (2013)  3-Biphenylimidazo[1,2-a]pyridines or [1,2-b]pyridazines and analogues, novel Flaviviridae inhibitors.,  64  [PMID:23665801] [10.1016/j.ejmech.2013.03.054]

Source