2-(4-Fluorophenyl)-3-(2'-methoxybiphenyl-3-yl)imidazo[1,2-a]pyridine

ID: ALA2393030

PubChem CID: 71699470

Max Phase: Preclinical

Molecular Formula: C26H19FN2O

Molecular Weight: 394.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1-c1cccc(-c2c(-c3ccc(F)cc3)nc3ccccn23)c1

Standard InChI:  InChI=1S/C26H19FN2O/c1-30-23-10-3-2-9-22(23)19-7-6-8-20(17-19)26-25(18-12-14-21(27)15-13-18)28-24-11-4-5-16-29(24)26/h2-17H,1H3

Standard InChI Key:  SKAKNLNNVVHOJF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -0.4567   -6.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4556   -7.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2556   -7.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2538   -6.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9624   -6.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9627   -7.3323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7457   -7.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2294   -6.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7453   -6.2546    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9980   -8.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4496   -8.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7018   -9.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5019   -9.9149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0494   -9.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7944   -8.5284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0433   -6.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4516   -7.6278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2680   -7.6279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6772   -6.9195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2639   -6.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4489   -6.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4944   -6.9181    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8488   -9.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1033  -10.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9025  -10.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4479   -9.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1886   -9.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3901   -8.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5582  -10.8544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7584  -10.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  8 16  1  0
 19 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 14 23  1  0
 24 29  1  0
 29 30  1  0
M  END

Associated Targets(Human)

Huh-5-2 (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.45Molecular Weight (Monoisotopic): 394.1481AlogP: 6.48#Rotatable Bonds: 4
Polar Surface Area: 26.53Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.04CX LogP: 5.99CX LogD: 5.99
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: -1.33

References

1. Enguehard-Gueiffier C, Musiu S, Henry N, Véron JB, Mavel S, Neyts J, Leyssen P, Paeshuyse J, Gueiffier A..  (2013)  3-Biphenylimidazo[1,2-a]pyridines or [1,2-b]pyridazines and analogues, novel Flaviviridae inhibitors.,  64  [PMID:23665801] [10.1016/j.ejmech.2013.03.054]

Source