2-(4-Fluorophenyl)-3-(3'-methoxybiphenyl-3-yl)imidazo[1,2-a]pyridine

ID: ALA2393031

PubChem CID: 71699547

Max Phase: Preclinical

Molecular Formula: C26H19FN2O

Molecular Weight: 394.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2cccc(-c3c(-c4ccc(F)cc4)nc4ccccn34)c2)c1

Standard InChI:  InChI=1S/C26H19FN2O/c1-30-23-9-5-7-20(17-23)19-6-4-8-21(16-19)26-25(18-11-13-22(27)14-12-18)28-24-10-2-3-15-29(24)26/h2-17H,1H3

Standard InChI Key:  KWYIDFOZLCRTIO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    6.8168   -7.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8156   -7.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5237   -8.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5219   -6.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2305   -7.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2307   -7.8606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0137   -8.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4974   -7.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0133   -6.7829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2660   -8.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7177   -9.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9698  -10.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7700  -10.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3175   -9.8308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0624   -9.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1168   -9.9962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3714  -10.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1705  -10.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7160  -10.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4567   -9.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6581   -9.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3114   -7.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7196   -8.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5361   -8.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9452   -7.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5320   -6.7379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7169   -6.7413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7624   -7.4464    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.9990   -8.9406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7996   -9.1046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 16  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  8 22  1  0
 25 28  1  0
 20 29  1  0
 29 30  1  0
M  END

Associated Targets(Human)

Huh-5-2 (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.45Molecular Weight (Monoisotopic): 394.1481AlogP: 6.48#Rotatable Bonds: 4
Polar Surface Area: 26.53Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.04CX LogP: 5.99CX LogD: 5.99
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: -1.40

References

1. Enguehard-Gueiffier C, Musiu S, Henry N, Véron JB, Mavel S, Neyts J, Leyssen P, Paeshuyse J, Gueiffier A..  (2013)  3-Biphenylimidazo[1,2-a]pyridines or [1,2-b]pyridazines and analogues, novel Flaviviridae inhibitors.,  64  [PMID:23665801] [10.1016/j.ejmech.2013.03.054]

Source