3-(4'-Chlorobiphenyl-3-yl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridine

ID: ALA2393034

PubChem CID: 71699550

Max Phase: Preclinical

Molecular Formula: C25H16ClFN2

Molecular Weight: 398.87

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Fc1ccc(-c2nc3ccccn3c2-c2cccc(-c3ccc(Cl)cc3)c2)cc1

Standard InChI:  InChI=1S/C25H16ClFN2/c26-21-11-7-17(8-12-21)19-4-3-5-20(16-19)25-24(18-9-13-22(27)14-10-18)28-23-6-1-2-15-29(23)25/h1-16H

Standard InChI Key:  VQZDJLODDLVEPG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   -0.0646  -14.4205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0635  -15.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6477  -15.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6459  -14.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3545  -14.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3548  -15.2401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1378  -15.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6215  -14.8281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1374  -14.1624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3901  -16.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8417  -16.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0939  -17.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8940  -17.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4415  -17.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1865  -16.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2409  -17.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4954  -18.1534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2946  -18.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8400  -17.7108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5807  -16.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7822  -16.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4354  -14.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8437  -15.5356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6601  -15.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0693  -14.8273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6560  -14.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8410  -14.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8865  -14.8259    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.6402  -17.8766    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 16  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  8 22  1  0
 25 28  1  0
 19 29  1  0
M  END

Associated Targets(Human)

Huh-5-2 (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.87Molecular Weight (Monoisotopic): 398.0986AlogP: 7.13#Rotatable Bonds: 3
Polar Surface Area: 17.30Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.04CX LogP: 6.75CX LogD: 6.75
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: -1.62

References

1. Enguehard-Gueiffier C, Musiu S, Henry N, Véron JB, Mavel S, Neyts J, Leyssen P, Paeshuyse J, Gueiffier A..  (2013)  3-Biphenylimidazo[1,2-a]pyridines or [1,2-b]pyridazines and analogues, novel Flaviviridae inhibitors.,  64  [PMID:23665801] [10.1016/j.ejmech.2013.03.054]

Source