3-[3-(Furan-3-yl)phenyl]-2-(4-fluorophenyl)imidazo[1,2-a]pyridine

ID: ALA2393038

PubChem CID: 71699621

Max Phase: Preclinical

Molecular Formula: C23H15FN2O

Molecular Weight: 354.38

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Fc1ccc(-c2nc3ccccn3c2-c2cccc(-c3ccoc3)c2)cc1

Standard InChI:  InChI=1S/C23H15FN2O/c24-20-9-7-16(8-10-20)22-23(26-12-2-1-6-21(26)25-22)18-5-3-4-17(14-18)19-11-13-27-15-19/h1-15H

Standard InChI Key:  IJPSEWYDPPOLOP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
    0.8535  -20.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8523  -21.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5678  -22.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5660  -20.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2821  -20.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2824  -21.6720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0735  -21.9289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5622  -21.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0731  -20.5830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3284  -22.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7744  -23.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0291  -24.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8377  -24.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3909  -23.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1331  -22.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1986  -23.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3847  -21.2541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7972  -21.9706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6223  -21.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0357  -21.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6181  -20.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7945  -20.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8614  -21.2536    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.5391  -24.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3590  -24.4930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5261  -23.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8095  -23.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 14 16  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  8 17  1  0
 20 23  1  0
 16 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 16  1  0
M  END

Associated Targets(Human)

Huh-5-2 (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.38Molecular Weight (Monoisotopic): 354.1168AlogP: 6.07#Rotatable Bonds: 3
Polar Surface Area: 30.44Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.04CX LogP: 5.29CX LogD: 5.29
Aromatic Rings: 5Heavy Atoms: 27QED Weighted: 0.39Np Likeness Score: -1.28

References

1. Enguehard-Gueiffier C, Musiu S, Henry N, Véron JB, Mavel S, Neyts J, Leyssen P, Paeshuyse J, Gueiffier A..  (2013)  3-Biphenylimidazo[1,2-a]pyridines or [1,2-b]pyridazines and analogues, novel Flaviviridae inhibitors.,  64  [PMID:23665801] [10.1016/j.ejmech.2013.03.054]

Source