3-(2'-Hydroxybiphenyl-3-yl)-2-(2-methoxyphenyl)imidazo[1,2-a]pyridine

ID: ALA2393042

PubChem CID: 71699625

Max Phase: Preclinical

Molecular Formula: C26H20N2O2

Molecular Weight: 392.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1-c1nc2ccccn2c1-c1cccc(-c2ccccc2O)c1

Standard InChI:  InChI=1S/C26H20N2O2/c1-30-23-14-5-3-12-21(23)25-26(28-16-7-6-15-24(28)27-25)19-10-8-9-18(17-19)20-11-2-4-13-22(20)29/h2-17,29H,1H3

Standard InChI Key:  XEBTXFVZKHETIT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    3.3870  -28.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3859  -29.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0939  -29.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0921  -27.9287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8008  -28.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8010  -29.1571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5840  -29.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0677  -28.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5836  -28.0794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8363  -30.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2879  -30.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5401  -31.5694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3402  -31.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8878  -31.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6327  -30.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6871  -31.2927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9417  -32.0704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7408  -32.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2862  -31.6278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0269  -30.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2284  -30.6850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8817  -28.7434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2899  -29.4526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1063  -29.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5155  -28.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1023  -28.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2872  -28.0378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8764  -27.3314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0592  -27.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3965  -32.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 16  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  8 22  1  0
 27 28  1  0
 28 29  1  0
 17 30  1  0
M  END

Associated Targets(Human)

Huh-5-2 (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.46Molecular Weight (Monoisotopic): 392.1525AlogP: 6.05#Rotatable Bonds: 4
Polar Surface Area: 46.76Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.67CX Basic pKa: 4.97CX LogP: 5.55CX LogD: 5.54
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -0.72

References

1. Enguehard-Gueiffier C, Musiu S, Henry N, Véron JB, Mavel S, Neyts J, Leyssen P, Paeshuyse J, Gueiffier A..  (2013)  3-Biphenylimidazo[1,2-a]pyridines or [1,2-b]pyridazines and analogues, novel Flaviviridae inhibitors.,  64  [PMID:23665801] [10.1016/j.ejmech.2013.03.054]

Source