The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-O-Methylisosilychristin ID: ALA2397732
PubChem CID: 73349003
Max Phase: Preclinical
Molecular Formula: C26H24O10
Molecular Weight: 496.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c2c(c1)O[C@H](c1ccc(O)c3c1[C@@H](CO)[C@H](c1ccc(O)c(OC)c1)O3)[C@@H](O)C2=O
Standard InChI: InChI=1S/C26H24O10/c1-33-12-8-17(30)21-19(9-12)35-25(23(32)22(21)31)13-4-6-16(29)26-20(13)14(10-27)24(36-26)11-3-5-15(28)18(7-11)34-2/h3-9,14,23-25,27-30,32H,10H2,1-2H3/t14-,23+,24+,25-/m1/s1
Standard InChI Key: VVQOMYSMOUXQNI-VEIHWBNBSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
22.7024 -27.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7013 -28.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4162 -28.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4144 -27.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1297 -27.4418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1331 -28.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8522 -28.6862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5727 -28.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5692 -27.4360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8455 -27.0200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2814 -27.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9974 -27.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7078 -27.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2882 -28.6795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.4147 -29.5107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8546 -29.5112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9879 -27.0332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7093 -26.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2775 -26.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9868 -25.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8097 -24.9797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9907 -24.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6619 -25.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4222 -25.7764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5727 -24.1886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9838 -23.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5665 -22.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7407 -22.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3339 -23.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7535 -24.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3217 -22.0581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9738 -22.0455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7988 -22.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8563 -25.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2995 -25.2230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9877 -26.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 12 2 0
12 13 1 0
19 11 1 0
9 11 1 6
18 13 2 0
8 14 1 1
3 15 1 0
7 16 2 0
1 17 1 0
20 18 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 19 1 0
18 24 1 0
22 25 1 6
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
27 32 1 0
32 33 1 0
23 34 1 1
34 35 1 0
17 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.47Molecular Weight (Monoisotopic): 496.1369AlogP: 2.71#Rotatable Bonds: 5Polar Surface Area: 155.14Molecular Species: NEUTRALHBA: 10HBD: 5#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.53CX Basic pKa: ┄CX LogP: 2.44CX LogD: 2.41Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: 1.87
References 1. Althagafy HS, Graf TN, Sy-Cordero AA, Gufford BT, Paine MF, Wagoner J, Polyak SJ, Croatt MP, Oberlies NH.. (2013) Semisynthesis, cytotoxicity, antiviral activity, and drug interaction liability of 7-O-methylated analogues of flavonolignans from milk thistle., 21 (13): [PMID:23673225 ] [10.1016/j.bmc.2013.04.017 ]