The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Isopropyl5-methyl4-isopropyl-6-(3-nitrophenyl)-2-oxo-2,3-dihydropyrimidine-1,5(6H)-dicarboxylate ID: ALA2398420
Max Phase: Preclinical
Molecular Formula: C19H23N3O7
Molecular Weight: 405.41
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(C(C)C)NC(=O)N(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1
Standard InChI: InChI=1S/C19H23N3O7/c1-10(2)15-14(17(23)28-5)16(12-7-6-8-13(9-12)22(26)27)21(18(24)20-15)19(25)29-11(3)4/h6-11,16H,1-5H3,(H,20,24)
Standard InChI Key: ZHQUFYKOKIITMM-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
16.2037 -25.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4891 -25.6108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7747 -25.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7747 -24.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4891 -23.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2037 -24.3733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9181 -23.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6326 -24.3733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9181 -23.1358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0602 -23.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0602 -23.1358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3457 -24.3733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9181 -25.6108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4891 -23.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7747 -22.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7747 -21.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4891 -21.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2037 -21.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2037 -22.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0602 -21.4857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0602 -20.6608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3457 -21.8983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0602 -25.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3457 -25.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0602 -26.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6312 -23.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6326 -22.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6326 -21.8983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3471 -23.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
6 7 1 0
10 11 2 0
10 12 1 0
4 10 1 0
1 13 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
20 21 2 0
20 22 1 0
16 20 1 0
5 14 1 0
23 24 1 0
23 25 1 0
3 23 1 0
12 26 1 0
27 28 1 0
27 29 1 0
9 27 1 0
M CHG 2 20 1 22 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.41Molecular Weight (Monoisotopic): 405.1536AlogP: 3.29#Rotatable Bonds: 5Polar Surface Area: 128.08Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.34CX Basic pKa: ┄CX LogP: 3.09CX LogD: 3.09Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.45Np Likeness Score: -0.76
References 1. Kang S, Cooper G, Dunne SF, Luan CH, James Surmeier D, Silverman RB.. (2013) Antagonism of L-type Ca2+ channels CaV1.3 and CaV1.2 by 1,4-dihydropyrimidines and 4H-pyrans as dihydropyridine mimics., 21 (14): [PMID:23688558 ] [10.1016/j.bmc.2013.04.054 ]