The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-amino-6-morpholin-4-yl-4-(3,4,5-trimethoxyphenyl)-pyridine-3,5-dicarbonitrile ID: ALA239894
PubChem CID: 24205480
Max Phase: Preclinical
Molecular Formula: C20H21N5O4
Molecular Weight: 395.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2c(C#N)c(N)nc(N3CCOCC3)c2C#N)cc(OC)c1OC
Standard InChI: InChI=1S/C20H21N5O4/c1-26-15-8-12(9-16(27-2)18(15)28-3)17-13(10-21)19(23)24-20(14(17)11-22)25-4-6-29-7-5-25/h8-9H,4-7H2,1-3H3,(H2,23,24)
Standard InChI Key: GXVDUQFXCRLSSI-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-3.1594 -8.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1606 -9.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4477 -9.6963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7283 -9.2829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7315 -8.4518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4497 -8.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0224 -8.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3101 -7.6199 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8756 -8.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5904 -7.6319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8757 -9.6948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0136 -9.6947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0142 -10.5192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3034 -10.9310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4131 -10.5213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4144 -9.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3009 -9.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4568 -7.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7428 -6.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7463 -5.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4631 -5.5707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1780 -5.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1709 -6.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4681 -4.7457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7562 -4.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8958 -5.5843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0335 -5.5652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3173 -5.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6068 -6.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 8 3 0
5 7 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
4 5 1 0
18 19 2 0
9 10 3 0
19 20 1 0
1 9 1 0
20 21 2 0
2 3 1 0
21 22 1 0
2 11 1 0
22 23 2 0
23 18 1 0
6 18 1 0
5 6 2 0
21 24 1 0
4 12 1 0
24 25 1 0
12 13 1 0
22 26 1 0
6 1 1 0
20 27 1 0
1 2 2 0
27 28 1 0
3 4 2 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.42Molecular Weight (Monoisotopic): 395.1594AlogP: 1.94#Rotatable Bonds: 5Polar Surface Area: 126.65Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.48CX LogP: 1.89CX LogD: 1.89Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.81Np Likeness Score: -0.85
References 1. Cocco MT, Congiu C, Lilliu V, Onnis V.. (2007) Synthesis and in vitro antitumoral activity of new 3,5-dicyanopyridine derivatives., 15 (4): [PMID:17142048 ] [10.1016/j.bmc.2006.11.031 ]