N-(5-(cyclopropylcarbamoyl)-2-methylphenyl)-5-(pyridin-4-yl)thiophene-2-carboxamide

ID: ALA2401998

PubChem CID: 59761450

Max Phase: Preclinical

Molecular Formula: C21H19N3O2S

Molecular Weight: 377.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)NC2CC2)cc1NC(=O)c1ccc(-c2ccncc2)s1

Standard InChI:  InChI=1S/C21H19N3O2S/c1-13-2-3-15(20(25)23-16-4-5-16)12-17(13)24-21(26)19-7-6-18(27-19)14-8-10-22-11-9-14/h2-3,6-12,16H,4-5H2,1H3,(H,23,25)(H,24,26)

Standard InChI Key:  YTGWXEIUYWQLJS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    3.2300  -28.5676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5146  -28.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8016  -29.3985    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.8029  -28.5696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0148  -28.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5266  -28.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0122  -29.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5128  -27.3334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2264  -26.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9386  -27.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6518  -26.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6504  -26.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9299  -25.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2198  -26.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5025  -25.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3670  -27.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3684  -28.1561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0807  -26.9173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7959  -27.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2065  -28.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6178  -27.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7589  -30.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0503  -30.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3103  -31.3861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2448  -32.0012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0557  -31.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3085  -31.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  4  1  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  3  1  0
  2  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 11 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 20 19  1  0
 21 20  1  0
 19 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  7 22  1  0
M  END

Associated Targets(Human)

MAPK11 Tchem MAP kinase p38 beta (2785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAPK13 Tchem MAP kinase p38 (1586 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAPK14 Tchem MAP kinase p38 alpha (12866 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.47Molecular Weight (Monoisotopic): 377.1198AlogP: 4.26#Rotatable Bonds: 5
Polar Surface Area: 71.09Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.14CX LogP: 3.46CX LogD: 3.46
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.70Np Likeness Score: -1.70

References

1. Wrobleski ST, Lin S, Dhar TG, Dyckman AJ, Li T, Pitt S, Zhang R, Fan Y, Doweyko AM, Tokarski JS, Kish KF, Kiefer SE, Sack JS, Newitt JA, Witmer MR, McKinnon M, Barrish JC, Dodd JH, Schieven GL, Leftheris K..  (2013)  The identification of novel p38α isoform selective kinase inhibitors having an unprecedented p38α binding mode.,  23  (14): [PMID:23746475] [10.1016/j.bmcl.2013.05.047]

Source