Isopropyl 1-allyl-2'-amino-1'-(isonicotinamido)-6,7',7'-trimethyl-2,5'-dioxo-1,1',2,4',5',6',7',8'-octahydro-3,4'-biquinoline-3'-carboxylate

ID: ALA2402129

PubChem CID: 71739841

Max Phase: Preclinical

Molecular Formula: C34H37N5O5

Molecular Weight: 595.70

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C=CCn1c(=O)c(C2C(C(=O)OC(C)C)=C(N)N(NC(=O)c3ccncc3)C3=C2C(=O)CC(C)(C)C3)cc2cc(C)ccc21

Standard InChI:  InChI=1S/C34H37N5O5/c1-7-14-38-24-9-8-20(4)15-22(24)16-23(32(38)42)27-28-25(17-34(5,6)18-26(28)40)39(30(35)29(27)33(43)44-19(2)3)37-31(41)21-10-12-36-13-11-21/h7-13,15-16,19,27H,1,14,17-18,35H2,2-6H3,(H,37,41)

Standard InChI Key:  HVXSEOAIUTYTMZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 44 48  0  0  0  0  0  0  0  0999 V2000
   20.3789  -14.9883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3777  -15.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8062  -14.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0908  -14.5755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8090  -15.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0917  -16.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0902  -17.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8052  -17.4661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5232  -17.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5213  -16.2263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2352  -15.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9503  -16.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6642  -15.8110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2387  -17.4608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8259  -18.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8165  -20.3917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5328  -19.9804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5367  -19.1528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1038  -19.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1091  -19.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4016  -18.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6886  -19.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6873  -19.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3953  -20.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2515  -18.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9657  -19.1539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2471  -17.9136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6805  -18.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8133  -21.2166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5262  -21.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5229  -22.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2423  -21.2223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8054  -22.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8019  -23.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5153  -24.1038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2338  -23.6897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2338  -22.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2459  -20.3955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4060  -17.9157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6811  -17.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3947  -19.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8844  -20.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6803  -20.7929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6643  -14.5760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
  9 14  2  0
  8 15  1  0
 15 20  1  0
 15 18  1  0
 19 16  1  0
 16 17  1  0
 17 18  2  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 19  1  0
 18 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 16 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  2  0
 31 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 31  1  0
 17 38  1  0
 21 39  2  0
 28 40  1  0
 28 41  1  0
 23 42  1  0
 23 43  1  0
  1 44  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2402129

   isopropyl 4-(1-allyl-6-methyl-2-oxo-3-quinolyl)-2-amino-7,7-dimethyl-5-oxo-1-(pyridine-4-carbonylamino)-6,8-dihydro-4H-quinoline-3-carboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 595.70

Molecular Weight (Monoisotopic): 595.2795

AlogP: 4.40

#Rotatable Bonds: 7

Polar Surface Area: 136.62

Molecular Species: NEUTRAL

HBA: 9

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 13.07

CX Basic pKa: 3.17

CX LogP: 3.35

CX LogD: 3.35

Aromatic Rings: 3

Heavy Atoms: 44

QED Weighted: 0.30

Np Likeness Score: -0.95

References

1. Jardosh HH, Patel MP..  (2013)  Design and synthesis of biquinolone-isoniazid hybrids as a new class of antitubercular and antimicrobial agents.,  65  [PMID:23747804] [10.1016/j.ejmech.2013.05.003]

Source

Source(1):

• Scientific Literature