The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-(9-cyclopentyl-6-(4-(pyridin-2-yl)benzylamino)-9H-purin-2-ylamino)butan-1-ol ID: ALA2402949
PubChem CID: 73347509
Max Phase: Preclinical
Molecular Formula: C26H31N7O
Molecular Weight: 457.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](CO)Nc1nc(NCc2ccc(-c3ccccn3)cc2)c2ncn(C3CCCC3)c2n1
Standard InChI: InChI=1S/C26H31N7O/c1-2-20(16-34)30-26-31-24(23-25(32-26)33(17-29-23)21-7-3-4-8-21)28-15-18-10-12-19(13-11-18)22-9-5-6-14-27-22/h5-6,9-14,17,20-21,34H,2-4,7-8,15-16H2,1H3,(H2,28,30,31,32)/t20-/m1/s1
Standard InChI Key: FLIJBHQHRINPMX-HXUWFJFHSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
15.4448 -8.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2323 -8.6286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4448 -7.5495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7283 -8.7912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2323 -7.2913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0158 -7.5495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0158 -8.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7283 -7.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7198 -7.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7199 -6.3122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2950 -8.7912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4907 -9.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4407 -5.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4324 -5.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5825 -8.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1576 -8.3787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8701 -8.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7158 -4.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1407 -4.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5825 -7.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8576 -7.1413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1323 -3.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7074 -3.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4199 -3.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0054 -10.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4944 -10.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2819 -10.4986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2796 -9.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4199 -2.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1351 -2.2063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1336 -1.3822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4178 -0.9704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7018 -1.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7069 -2.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 1 2 0
5 3 1 0
6 7 2 0
7 4 1 0
8 3 2 0
9 2 1 0
10 8 1 0
11 7 1 0
12 2 1 0
13 10 1 0
14 13 1 0
15 11 1 0
16 17 1 0
17 15 1 0
18 14 2 0
19 14 1 0
15 20 1 1
21 20 1 0
22 19 2 0
23 18 1 0
24 22 1 0
8 6 1 0
9 5 2 0
23 24 2 0
27 28 1 0
25 26 1 0
12 25 1 0
26 27 1 0
28 12 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
24 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.58Molecular Weight (Monoisotopic): 457.2590AlogP: 4.80#Rotatable Bonds: 9Polar Surface Area: 100.78Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.26CX LogP: 4.29CX LogD: 4.29Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -0.82
References 1. Gucký T, Jorda R, Zatloukal M, Bazgier V, Berka K, Řezníčková E, Béres T, Strnad M, Kryštof V.. (2013) A novel series of highly potent 2,6,9-trisubstituted purine cyclin-dependent kinase inhibitors., 56 (15): [PMID:23829517 ] [10.1021/jm4006884 ]