The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1,N1'-[1,4-Phenylenebis(methylene)]bis{N4-[4-(methylamino)-butyl]butane-1,4-diamine}hexahydrochloride ID: ALA2403109
PubChem CID: 73347512
Max Phase: Preclinical
Molecular Formula: C26H53ClN6
Molecular Weight: 448.74
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNCCCCNCCCCNCc1ccc(CNCCCCNCCCCNC)cc1.Cl
Standard InChI: InChI=1S/C26H52N6.ClH/c1-27-15-3-5-17-29-19-7-9-21-31-23-25-11-13-26(14-12-25)24-32-22-10-8-20-30-18-6-4-16-28-2;/h11-14,27-32H,3-10,15-24H2,1-2H3;1H
Standard InChI Key: UIOGCCHGMKTTFN-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 32 0 0 0 0 0 0 0 0999 V2000
17.4684 -11.7562 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.2224 -10.1396 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5085 -10.5530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7935 -10.1414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0796 -10.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3646 -10.1433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6506 -10.5567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9357 -10.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2217 -10.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5067 -10.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7928 -10.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0778 -10.1488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9374 -10.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6513 -10.1377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3701 -8.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6529 -9.3129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0823 -9.3127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0842 -10.1362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3654 -10.5502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7963 -8.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5112 -9.3109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2252 -8.8975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9401 -9.3091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6541 -8.8957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3690 -9.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0830 -8.8937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7979 -9.3053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5119 -8.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2269 -9.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9408 -8.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6558 -9.3017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3698 -8.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0768 -9.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
2 13 1 0
13 14 1 0
15 16 1 0
16 14 2 0
14 19 1 0
18 17 1 0
17 15 2 0
18 19 2 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
12 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.74Molecular Weight (Monoisotopic): 448.4253AlogP: 2.60#Rotatable Bonds: 24Polar Surface Area: 72.18Molecular Species: BASEHBA: 6HBD: 6#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 11.28CX LogP: 1.94CX LogD: -14.07Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.14Np Likeness Score: -0.10
References 1. Muth A, Kamel J, Kaur N, Shicora AC, Ayene IS, Gilmour SK, Phanstiel O.. (2013) Development of polyamine transport ligands with improved metabolic stability and selectivity against specific human cancers., 56 (14): [PMID:23841465 ] [10.1021/jm400496a ]