N1,N1'-[1,4-Phenylenebis(methylene)]bis{N4-[4-(methylamino)-butyl]butane-1,4-diamine}hexahydrochloride

ID: ALA2403109

PubChem CID: 73347512

Max Phase: Preclinical

Molecular Formula: C26H53ClN6

Molecular Weight: 448.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCCCCNCCCCNCc1ccc(CNCCCCNCCCCNC)cc1.Cl

Standard InChI:  InChI=1S/C26H52N6.ClH/c1-27-15-3-5-17-29-19-7-9-21-31-23-25-11-13-26(14-12-25)24-32-22-10-8-20-30-18-6-4-16-28-2;/h11-14,27-32H,3-10,15-24H2,1-2H3;1H

Standard InChI Key:  UIOGCCHGMKTTFN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 32  0  0  0  0  0  0  0  0999 V2000
   17.4684  -11.7562    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.2224  -10.1396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5085  -10.5530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7935  -10.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0796  -10.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3646  -10.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6506  -10.5567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9357  -10.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2217  -10.5585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5067  -10.1469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7928  -10.5604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0778  -10.1488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9374  -10.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6513  -10.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3701   -8.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6529   -9.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0823   -9.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0842  -10.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3654  -10.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7963   -8.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5112   -9.3109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2252   -8.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9401   -9.3091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6541   -8.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3690   -9.3072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0830   -8.8937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7979   -9.3053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5119   -8.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2269   -9.3035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9408   -8.8901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6558   -9.3017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3698   -8.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0768   -9.3238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  2 13  1  0
 13 14  1  0
 15 16  1  0
 16 14  2  0
 14 19  1  0
 18 17  1  0
 17 15  2  0
 18 19  2  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 12 33  1  0
M  END

Associated Targets(Human)

Malme-3M (44254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

CHO-MG (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.74Molecular Weight (Monoisotopic): 448.4253AlogP: 2.60#Rotatable Bonds: 24
Polar Surface Area: 72.18Molecular Species: BASEHBA: 6HBD: 6
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 11.28CX LogP: 1.94CX LogD: -14.07
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.14Np Likeness Score: -0.10

References

1. Muth A, Kamel J, Kaur N, Shicora AC, Ayene IS, Gilmour SK, Phanstiel O..  (2013)  Development of polyamine transport ligands with improved metabolic stability and selectivity against specific human cancers.,  56  (14): [PMID:23841465] [10.1021/jm400496a]

Source