N1,N1'-(naphthalene-1,4-diylbis(methylene))bis(N4-(4-(methylamino)butyl)butane-1,4-diamine)hexahydrochloride

ID: ALA2403110

PubChem CID: 73350614

Max Phase: Preclinical

Molecular Formula: C30H55ClN6

Molecular Weight: 498.80

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCCCCNCCCCNCc1ccc(CNCCCCNCCCCNC)c2ccccc12.Cl

Standard InChI:  InChI=1S/C30H54N6.ClH/c1-31-17-5-7-19-33-21-9-11-23-35-25-27-15-16-28(30-14-4-3-13-29(27)30)26-36-24-12-10-22-34-20-8-6-18-32-2;/h3-4,13-16,31-36H,5-12,17-26H2,1-2H3;1H

Standard InChI Key:  RYCSDJTUUZBBTK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 37  0  0  0  0  0  0  0  0999 V2000
   15.7300  -30.7902    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.4975  -29.3602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7835  -29.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0685  -29.3620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3546  -29.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6395  -29.3638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9257  -29.7772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2106  -29.3656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4967  -29.7790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7817  -29.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0678  -29.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3528  -29.3693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2124  -29.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9264  -29.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6451  -28.1223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9279  -28.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3573  -28.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3593  -29.3567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6403  -29.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6404  -30.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3586  -31.0133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0784  -30.5942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0748  -29.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0712  -28.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7863  -28.5314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5001  -28.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2152  -28.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9291  -28.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6441  -28.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3580  -28.1143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0730  -28.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7869  -28.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5019  -28.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2158  -28.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9308  -28.5222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6447  -28.1088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3517  -28.5443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  2 13  1  0
 13 14  1  0
 15 16  1  0
 16 14  2  0
 14 19  1  0
 18 17  1  0
 17 15  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 18  2  0
 17 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 12 37  1  0
M  END

Associated Targets(Human)

Malme-3M (44254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
UACC-257 (46019 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
T47D (39041 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

CHO-MG (239 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.80Molecular Weight (Monoisotopic): 498.4410AlogP: 3.76#Rotatable Bonds: 24
Polar Surface Area: 72.18Molecular Species: BASEHBA: 6HBD: 6
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 11.29CX LogP: 2.93CX LogD: -13.62
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: -0.08

References

1. Muth A, Kamel J, Kaur N, Shicora AC, Ayene IS, Gilmour SK, Phanstiel O..  (2013)  Development of polyamine transport ligands with improved metabolic stability and selectivity against specific human cancers.,  56  (14): [PMID:23841465] [10.1021/jm400496a]

Source