(rac)-3-({2-[Tris(4-methoxyphenyl)methoxy]ethyl}amino)butanoic acid

ID: ALA2403792

PubChem CID: 71739728

Max Phase: Preclinical

Molecular Formula: C28H33NO6

Molecular Weight: 479.57

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1ccc(C(OCCNC(C)CC(=O)O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1

Standard InChI:  InChI=1S/C28H33NO6/c1-20(19-27(30)31)29-17-18-35-28(21-5-11-24(32-2)12-6-21,22-7-13-25(33-3)14-8-22)23-9-15-26(34-4)16-10-23/h5-16,20,29H,17-19H2,1-4H3,(H,30,31)

Standard InChI Key:  FLSWCXOAXOLNGC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   16.7710   -7.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0707   -7.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0991   -8.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8254   -8.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7449   -6.2492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4996   -7.4609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3989   -8.7693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6702   -8.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9700   -8.8160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2436   -8.4299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5433   -8.8661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9773   -9.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7995   -9.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2356  -10.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8497  -10.9633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0240  -10.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5878  -10.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2858  -11.6635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1079  -11.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8431   -9.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8693  -10.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1690  -10.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4426  -10.1746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4142   -9.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1146   -8.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7423  -10.6107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0137  -10.2212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1050   -8.1623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2793   -8.1907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8432   -7.4904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2327   -6.7618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0548   -6.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4910   -7.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7966   -6.0616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1826   -5.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  1  5  2  0
  1  6  1  0
  8  9  1  0
 10 11  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 18 19  1  0
 15 18  1  0
 11 12  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 26 27  1  0
 23 26  1  0
 11 20  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 28 33  2  0
 34 35  1  0
 31 34  1  0
 11 28  1  0
  9 10  1  0
  7  8  1  0
  3  7  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2403792

   3-[2-[Tris(4-methoxyphenyl)methoxy]ethylamino]butanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 479.57

Molecular Weight (Monoisotopic): 479.2308

AlogP: 4.47

#Rotatable Bonds: 13

Polar Surface Area: 86.25

Molecular Species: ZWITTERION

HBA: 6

HBD: 2

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 2

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 3.12

CX Basic pKa: 9.77

CX LogP: 2.10

CX LogD: 2.10

Aromatic Rings: 3

Heavy Atoms: 35

QED Weighted: 0.28

Np Likeness Score: -0.15

References

1. Sitka I, Allmendinger L, Fülep G, Höfner G, Wanner KT..  (2013)  Synthesis of N-substituted acyclic β-amino acids and their investigation as GABA uptake inhibitors.,  65  [PMID:23770450] [10.1016/j.ejmech.2013.04.063]

Source

Source(1):

• Scientific Literature