The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
threo-(S)-Methyl-2-((2R,3S)-3-hydroxy-2-((S)-4-isobutyl-3-methyl-5-oxoimidazolidin-1-yl)-3-phenylpropanamido)-3-phenylpropanoate ID: ALA2407366
PubChem CID: 71745901
Max Phase: Preclinical
Molecular Formula: C27H35N3O5
Molecular Weight: 481.59
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]([C@@H](O)c1ccccc1)N1CN(C)[C@@H](CC(C)C)C1=O
Standard InChI: InChI=1S/C27H35N3O5/c1-18(2)15-22-26(33)30(17-29(22)3)23(24(31)20-13-9-6-10-14-20)25(32)28-21(27(34)35-4)16-19-11-7-5-8-12-19/h5-14,18,21-24,31H,15-17H2,1-4H3,(H,28,32)/t21-,22-,23+,24-/m0/s1
Standard InChI Key: XVCCUGAXGDZMOX-XQUALCHDSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
11.8333 -13.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1188 -12.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1189 -12.1050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8333 -14.1676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5478 -12.9300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4044 -11.6925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4044 -10.8675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6899 -10.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9754 -10.8675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9754 -11.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6899 -12.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4044 -14.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6899 -14.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9754 -14.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1189 -14.5800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4044 -13.3426 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2610 -14.5801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2610 -15.4050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5465 -15.8175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8320 -15.4050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8320 -14.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5465 -14.1676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0225 -15.8899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2774 -16.6746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1024 -16.6746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3573 -15.8899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6899 -15.4051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1420 -15.6350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7925 -17.3421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5873 -17.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2518 -18.0957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7367 -18.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4312 -18.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9755 -13.3425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5478 -12.1050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 2 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
3 6 1 0
12 13 1 0
13 14 1 0
12 15 2 0
12 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
14 17 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
23 27 1 0
26 28 2 0
24 29 1 0
30 31 1 0
31 32 1 0
31 33 1 0
25 30 1 6
13 27 1 6
14 34 1 6
2 16 1 1
5 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.59Molecular Weight (Monoisotopic): 481.2577AlogP: 2.14#Rotatable Bonds: 10Polar Surface Area: 99.18Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.30CX Basic pKa: 3.74CX LogP: 3.12CX LogD: 3.12Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.50Np Likeness Score: 0.67
References 1. Mostardeiro MA, Ilha V, Dahmer J, Caro MS, Dalcol II, da Silva UF, Morel AF.. (2013) Cyclopeptide alkaloids: stereochemistry and synthesis of the precursors of discarines C and D and myrianthine A., 76 (7): [PMID:23819826 ] [10.1021/np400313w ]