erythro-(S)-Methyl-2-((2R,3R)-2-((S)-2-(dimethylamino)-4-methylpentanamido)-3-(4-formylphenoxy)-3-phenylpropanamido)-4-methylpentanoate

ID: ALA2407369

PubChem CID: 71745903

Max Phase: Preclinical

Molecular Formula: C31H43N3O6

Molecular Weight: 553.70

Molecule Type: Protein

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(=O)[C@H](CC(C)C)N(C)C)[C@H](Oc1ccc(C=O)cc1)c1ccccc1

Standard InChI:  InChI=1S/C31H43N3O6/c1-20(2)17-25(31(38)39-7)32-30(37)27(33-29(36)26(34(5)6)18-21(3)4)28(23-11-9-8-10-12-23)40-24-15-13-22(19-35)14-16-24/h8-16,19-21,25-28H,17-18H2,1-7H3,(H,32,37)(H,33,36)/t25-,26-,27+,28+/m0/s1

Standard InChI Key:  AOPPXWOWDLPBRE-YVHASNINSA-N

Molfile:  

     RDKit          2D

 40 41  0  0  0  0  0  0  0  0999 V2000
   13.2684  -13.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5539  -13.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5539  -14.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2684  -15.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9828  -14.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9828  -13.9747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2684  -12.7372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2684  -16.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1249  -13.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4105  -13.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4105  -12.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1249  -14.7997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8394  -13.5622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6960  -12.3247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9815  -12.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2671  -12.3247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2671  -11.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9815  -11.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6960  -11.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1249  -12.3247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1249  -11.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8394  -11.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8394  -10.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1249   -9.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4105  -10.2622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4105  -11.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1249   -9.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8394   -8.6122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6960  -14.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9815  -15.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9815  -16.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2671  -16.4497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2671  -17.2747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4105  -15.2122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6960  -13.9747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5526  -16.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2671  -14.7997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5526  -15.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2671  -13.9747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5539  -12.3247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  6  2  0
  1  7  1  0
  4  8  1  0
  9 10  1  0
 10 11  1  0
  9 12  2  0
  9 13  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
 11 14  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 21 26  2  0
 20 21  1  0
 27 28  2  0
 24 27  1  0
 11 20  1  1
 29 30  1  0
 30 31  1  6
 31 32  1  0
 32 33  1  0
 29 34  2  0
 29 35  1  0
 32 36  1  0
 37 38  1  0
 37 39  1  0
 30 37  1  0
 10 35  1  6
  2 13  1  6
  7 40  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2407369

   methyl (2S)-2-[[(2R,3R)-2-[[(2S)-2-(dimethylamino)-4-methylpentanoyl]amino]-3-(4-formylphenoxy)-3-phenylpropanoyl]amino]-4-methylpentanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Protein

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 553.70

Molecular Weight (Monoisotopic): 553.3152

AlogP: 3.78

#Rotatable Bonds: 15

Polar Surface Area: 114.04

Molecular Species: NEUTRAL

HBA: 7

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 11.85

CX Basic pKa: 7.80

CX LogP: 4.60

CX LogD: 4.06

Aromatic Rings: 2

Heavy Atoms: 40

QED Weighted: 0.25

Np Likeness Score: 0.38

References

1. Mostardeiro MA, Ilha V, Dahmer J, Caro MS, Dalcol II, da Silva UF, Morel AF..  (2013)  Cyclopeptide alkaloids: stereochemistry and synthesis of the precursors of discarines C and D and myrianthine A.,  76  (7): [PMID:23819826] [10.1021/np400313w]

Source

Source(1):

• Scientific Literature