erythro-(S)-methyl 2-((2R,3R)-3-(4-formylphenoxy)-2-((S)-4-isobutyl-3-methyl-5-oxoimidazolidin-1-yl)-3-phenylpropanamido)-4-methylpentanoate

ID: ALA2407375

PubChem CID: 71746074

Max Phase: Preclinical

Molecular Formula: C31H41N3O6

Molecular Weight: 551.68

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](CC(C)C)NC(=O)[C@@H]([C@H](Oc1ccc(C=O)cc1)c1ccccc1)N1CN(C)[C@@H](CC(C)C)C1=O

Standard InChI:  InChI=1S/C31H41N3O6/c1-20(2)16-25(31(38)39-6)32-29(36)27(34-19-33(5)26(30(34)37)17-21(3)4)28(23-10-8-7-9-11-23)40-24-14-12-22(18-35)13-15-24/h7-15,18,20-21,25-28H,16-17,19H2,1-6H3,(H,32,36)/t25-,26-,27+,28+/m0/s1

Standard InChI Key:  FOFKTZSZENIWRZ-YVHASNINSA-N

Molfile:  

     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
   12.1225  -13.3715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4080  -13.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4080  -14.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1225  -15.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8370  -14.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8370  -13.7840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1224  -12.5465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9790  -13.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2647  -13.3715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2646  -12.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9791  -14.6090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6936  -13.3715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5501  -12.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8356  -12.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1211  -12.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1212  -11.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8356  -10.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5501  -11.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7964  -13.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2444  -14.0616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6569  -14.7760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4639  -14.6045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5502  -13.7840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0770  -15.1565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4239  -13.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3213  -15.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5009  -15.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1653  -16.3696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0160  -14.9485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9790  -12.1340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9790  -11.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2647  -10.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2647  -10.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9790   -9.6590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6935  -10.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6936  -10.8965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9791   -8.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6936   -8.4215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4080  -12.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1225  -15.8465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  1  6  2  0
  1  7  1  0
  8  9  1  0
  9 10  1  0
  8 11  2  0
  8 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
 10 13  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 19 23  1  0
 22 24  2  0
 20 25  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 21 26  1  6
  9 23  1  6
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 31 36  2  0
 30 31  1  0
 37 38  2  0
 34 37  1  0
 10 30  1  1
  2 12  1  6
  7 39  1  0
  4 40  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2407375

   methyl (2S)-2-[[(2R,3R)-3-(4-formylphenoxy)-2-[(4S)-3-methyl-4-(2-methylpropyl)-5-oxoimidazolidin-1-yl]-3-phenylpropanoyl]amino]-4-methylpentanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 551.68

Molecular Weight (Monoisotopic): 551.2995

AlogP: 3.84

#Rotatable Bonds: 13

Polar Surface Area: 105.25

Molecular Species: NEUTRAL

HBA: 7

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 12.18

CX Basic pKa: 3.95

CX LogP: 4.76

CX LogD: 4.76

Aromatic Rings: 2

Heavy Atoms: 40

QED Weighted: 0.30

Np Likeness Score: 0.64

References

1. Mostardeiro MA, Ilha V, Dahmer J, Caro MS, Dalcol II, da Silva UF, Morel AF..  (2013)  Cyclopeptide alkaloids: stereochemistry and synthesis of the precursors of discarines C and D and myrianthine A.,  76  (7): [PMID:23819826] [10.1021/np400313w]

Source

Source(1):

• Scientific Literature