25-hydroxy physalin F

ID: ALA2408035

PubChem CID: 73350641

Max Phase: Preclinical

Molecular Formula: C28H30O11

Molecular Weight: 542.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@]12C[C@H]3OC(=O)[C@]1(O)CO[C@]14O[C@@]5([C@H]2C1=O)[C@@]3(C)OC(=O)[C@@]5(O)CC[C@H]1[C@H]4C[C@H]2O[C@]23CC=CC(=O)[C@]13C

Standard InChI:  InChI=1S/C28H30O11/c1-21-10-16-23(3)28-17(21)18(30)27(39-28,35-11-25(21,34)19(31)36-16)13-9-15-26(37-15)7-4-5-14(29)22(26,2)12(13)6-8-24(28,33)20(32)38-23/h4-5,12-13,15-17,33-34H,6-11H2,1-3H3/t12-,13+,15+,16+,17-,21-,22-,23-,24-,25+,26+,27+,28-/m0/s1

Standard InChI Key:  NNEHHIZQBATWHK-WDUQUUMJSA-N

Molfile:  

     RDKit          2D

 44 52  0  0  0  0  0  0  0  0999 V2000
    1.6957   -8.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9000   -9.6869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7207   -7.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9000   -8.8745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3874   -9.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1206   -8.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3707   -9.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6832   -9.4619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9374   -7.5246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8498   -8.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4375   -8.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4498   -7.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5249   -9.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2374  -10.0869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1833  -10.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8873   -7.4745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9082  -11.3576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1873   -7.0371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1581   -7.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8123  -11.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1958   -8.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9416   -9.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5167   -8.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1749  -10.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8623  -10.5244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3917   -8.1495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6206   -7.0871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6540  -10.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3083   -9.4495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6623  -10.8868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9374   -8.8453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7124   -6.9871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1123   -9.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9498  -11.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2416   -9.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5622   -8.7119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6623   -6.6205    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3957   -8.2495    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5500  -10.5077    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4958  -10.8619    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5375  -11.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2416  -10.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2542  -11.7195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3250  -12.1159    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  8  1  0
  3  1  1  0
  4  1  1  0
  5  1  1  0
  6  5  1  0
  7  5  1  0
  1  8  1  6
  9  3  1  0
 10  6  1  0
 11  4  1  0
 12  3  1  0
 13 15  1  0
 14 13  1  0
 15  2  1  0
 16 10  1  0
  2 17  1  6
 18 12  1  0
 19  6  1  0
 20 17  1  0
 21  4  1  0
 22 14  1  0
 41 24  1  0
 23 21  1  0
 24 15  1  0
 25  7  2  0
 26 11  2  0
 27 16  2  0
 28 22  1  0
  4 29  1  1
 30 34  1  0
 31 22  2  0
  3 32  1  6
  6 33  1  1
 34 42  1  0
 14 35  1  1
 10 36  1  1
 12 37  1  1
  5 38  1  1
 13 39  1  6
 15 40  1  1
  2  7  1  0
  9 11  1  0
 12 19  1  0
 13 23  1  0
 18 16  1  0
 10 20  1  0
 14 42  1  0
 28 30  2  0
 42 41  1  0
 42 43  1  1
 41 43  1  0
 41 44  1  6
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

NFKBIA Tchem NF-kappaB inhibitor alpha (187 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 542.54Molecular Weight (Monoisotopic): 542.1788AlogP: -0.12#Rotatable Bonds:
Polar Surface Area: 158.19Molecular Species: NEUTRALHBA: 11HBD: 2
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.93CX Basic pKa: CX LogP: 1.33CX LogD: 1.33
Aromatic Rings: Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: 3.49

References

1. Ozawa M, Morita M, Hirai G, Tamura S, Kawai M, Tsuchiya A, Oonuma K, Maruoka K, Sodeoka M..  (2013)  Contribution of Cage-Shaped Structure of Physalins to Their Mode of Action in Inhibition of NF-κB Activation.,  (8): [PMID:24900739] [10.1021/ml400144e]

Source