The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
25-hydroxy physalin F ID: ALA2408035
PubChem CID: 73350641
Max Phase: Preclinical
Molecular Formula: C28H30O11
Molecular Weight: 542.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@]12C[C@H]3OC(=O)[C@]1(O)CO[C@]14O[C@@]5([C@H]2C1=O)[C@@]3(C)OC(=O)[C@@]5(O)CC[C@H]1[C@H]4C[C@H]2O[C@]23CC=CC(=O)[C@]13C
Standard InChI: InChI=1S/C28H30O11/c1-21-10-16-23(3)28-17(21)18(30)27(39-28,35-11-25(21,34)19(31)36-16)13-9-15-26(37-15)7-4-5-14(29)22(26,2)12(13)6-8-24(28,33)20(32)38-23/h4-5,12-13,15-17,33-34H,6-11H2,1-3H3/t12-,13+,15+,16+,17-,21-,22-,23-,24-,25+,26+,27+,28-/m0/s1
Standard InChI Key: NNEHHIZQBATWHK-WDUQUUMJSA-N
Molfile:
RDKit 2D
44 52 0 0 0 0 0 0 0 0999 V2000
1.6957 -8.6328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9000 -9.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7207 -7.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9000 -8.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3874 -9.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1206 -8.6870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3707 -9.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6832 -9.4619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9374 -7.5246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8498 -8.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4375 -8.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4498 -7.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5249 -9.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2374 -10.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1833 -10.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8873 -7.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9082 -11.3576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1873 -7.0371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1581 -7.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8123 -11.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1958 -8.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9416 -9.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5167 -8.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1749 -10.9118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8623 -10.5244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3917 -8.1495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6206 -7.0871 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6540 -10.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3083 -9.4495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6623 -10.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9374 -8.8453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7124 -6.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1123 -9.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9498 -11.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2416 -9.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5622 -8.7119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6623 -6.6205 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.3957 -8.2495 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.5500 -10.5077 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4958 -10.8619 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.5375 -11.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2416 -10.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2542 -11.7195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3250 -12.1159 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 8 1 0
3 1 1 0
4 1 1 0
5 1 1 0
6 5 1 0
7 5 1 0
1 8 1 6
9 3 1 0
10 6 1 0
11 4 1 0
12 3 1 0
13 15 1 0
14 13 1 0
15 2 1 0
16 10 1 0
2 17 1 6
18 12 1 0
19 6 1 0
20 17 1 0
21 4 1 0
22 14 1 0
41 24 1 0
23 21 1 0
24 15 1 0
25 7 2 0
26 11 2 0
27 16 2 0
28 22 1 0
4 29 1 1
30 34 1 0
31 22 2 0
3 32 1 6
6 33 1 1
34 42 1 0
14 35 1 1
10 36 1 1
12 37 1 1
5 38 1 1
13 39 1 6
15 40 1 1
2 7 1 0
9 11 1 0
12 19 1 0
13 23 1 0
18 16 1 0
10 20 1 0
14 42 1 0
28 30 2 0
42 41 1 0
42 43 1 1
41 43 1 0
41 44 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.54Molecular Weight (Monoisotopic): 542.1788AlogP: -0.12#Rotatable Bonds: ┄Polar Surface Area: 158.19Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.93CX Basic pKa: ┄CX LogP: 1.33CX LogD: 1.33Aromatic Rings: ┄Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: 3.49
References 1. Ozawa M, Morita M, Hirai G, Tamura S, Kawai M, Tsuchiya A, Oonuma K, Maruoka K, Sodeoka M.. (2013) Contribution of Cage-Shaped Structure of Physalins to Their Mode of Action in Inhibition of NF-κB Activation., 4 (8): [PMID:24900739 ] [10.1021/ml400144e ]