25-hydroxy physalin J

ID: ALA2408036

PubChem CID: 73346012

Max Phase: Preclinical

Molecular Formula: C28H30O11

Molecular Weight: 542.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@]12C[C@H]3OC(=O)[C@]1(O)CO[C@]14O[C@@]5([C@H]2C1=O)[C@@]3(C)OC(=O)[C@@]5(O)CC[C@H]1[C@H]4C[C@@H]2O[C@@]23CC=CC(=O)[C@]13C

Standard InChI:  InChI=1S/C28H30O11/c1-21-10-16-23(3)28-17(21)18(30)27(39-28,35-11-25(21,34)19(31)36-16)13-9-15-26(37-15)7-4-5-14(29)22(26,2)12(13)6-8-24(28,33)20(32)38-23/h4-5,12-13,15-17,33-34H,6-11H2,1-3H3/t12-,13+,15-,16+,17-,21-,22-,23-,24-,25+,26-,27+,28-/m0/s1

Standard InChI Key:  NNEHHIZQBATWHK-QGPQVMFISA-N

Molfile:  

     RDKit          2D

 44 52  0  0  0  0  0  0  0  0999 V2000
   18.7905   -8.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9947   -9.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8156   -7.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9947   -8.9203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4821   -9.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2154   -8.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4655   -9.9077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7780   -9.5077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0322   -7.5704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9446   -8.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5323   -8.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5446   -7.4704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5698   -9.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8573  -10.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2781  -10.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9820   -7.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0031  -11.4034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2820   -7.0829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2530   -7.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9070  -11.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2906   -8.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1532   -9.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5781   -8.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2698  -10.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9571  -10.5702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7032   -8.1954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7153   -7.1329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4408  -10.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4031   -9.4953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4324  -10.9326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1575   -8.8911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8072   -7.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2071   -9.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1449  -11.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8532   -9.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6570   -8.7578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7571   -6.6663    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.4905   -8.2953    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.5448  -10.5536    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.5906  -10.9077    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.5573  -11.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8532  -10.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8409  -11.7653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7698  -12.1618    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  8  1  0
  3  1  1  0
  4  1  1  0
  5  1  1  0
  6  5  1  0
  7  5  1  0
  1  8  1  6
  9  3  1  0
 10  6  1  0
 11  4  1  0
 12  3  1  0
 13 15  1  0
 14 13  1  0
 15  2  1  0
 16 10  1  0
  2 17  1  6
 18 12  1  0
 19  6  1  0
 20 17  1  0
 21  4  1  0
 22 14  1  0
 41 24  1  0
 23 21  1  0
 24 15  1  0
 25  7  2  0
 26 11  2  0
 27 16  2  0
 28 22  1  0
  4 29  1  1
 30 34  1  0
 31 22  2  0
  3 32  1  6
  6 33  1  1
 34 42  1  0
 14 35  1  1
 10 36  1  1
 12 37  1  1
  5 38  1  1
 13 39  1  6
 15 40  1  1
  2  7  1  0
  9 11  1  0
 12 19  1  0
 13 23  1  0
 18 16  1  0
 10 20  1  0
 14 42  1  0
 28 30  2  0
 42 41  1  0
 42 43  1  6
 41 43  1  0
 41 44  1  1
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

NFKBIA Tchem NF-kappaB inhibitor alpha (187 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 542.54Molecular Weight (Monoisotopic): 542.1788AlogP: -0.12#Rotatable Bonds:
Polar Surface Area: 158.19Molecular Species: NEUTRALHBA: 11HBD: 2
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.93CX Basic pKa: CX LogP: 1.33CX LogD: 1.33
Aromatic Rings: Heavy Atoms: 39QED Weighted: 0.31Np Likeness Score: 3.49

References

1. Ozawa M, Morita M, Hirai G, Tamura S, Kawai M, Tsuchiya A, Oonuma K, Maruoka K, Sodeoka M..  (2013)  Contribution of Cage-Shaped Structure of Physalins to Their Mode of Action in Inhibition of NF-κB Activation.,  (8): [PMID:24900739] [10.1021/ml400144e]

Source