The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-chloro-7-hydroxy-1-(2'-hydroxy-3'-methoxybiphenyl-4-yl)-6-phenyl-1H-pyrrolo[3,2-b]pyridin-5(4H)-one ID: ALA2408235
PubChem CID: 54727473
Max Phase: Preclinical
Molecular Formula: C26H19ClN2O4
Molecular Weight: 458.90
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(-c2ccc(-n3c(Cl)cc4[nH]c(=O)c(-c5ccccc5)c(O)c43)cc2)c1O
Standard InChI: InChI=1S/C26H19ClN2O4/c1-33-20-9-5-8-18(24(20)30)15-10-12-17(13-11-15)29-21(27)14-19-23(29)25(31)22(26(32)28-19)16-6-3-2-4-7-16/h2-14,30H,1H3,(H2,28,31,32)
Standard InChI Key: ZYDQKSGHSBJFMP-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
28.8479 -11.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8468 -11.8763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5548 -12.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2645 -11.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2616 -11.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5530 -10.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5565 -13.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8471 -13.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8465 -14.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5547 -14.7342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2648 -14.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2619 -13.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5523 -15.5536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8917 -16.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1450 -16.8116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2139 -16.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9639 -16.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5091 -17.4124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3072 -17.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5571 -16.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0090 -15.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2581 -15.0794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8551 -17.8489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3523 -16.2906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9678 -10.6419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6770 -11.0479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9728 -12.2834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.1142 -15.7830 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.9003 -16.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6949 -16.7195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9419 -15.9428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3883 -15.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5959 -15.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
13 14 1 0
14 15 2 0
15 17 1 0
16 13 1 0
10 13 1 0
16 17 2 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
19 23 2 0
20 24 1 0
5 25 1 0
25 26 1 0
4 27 1 0
14 28 1 0
24 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 24 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.90Molecular Weight (Monoisotopic): 458.1033AlogP: 5.73#Rotatable Bonds: 4Polar Surface Area: 87.48Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.58CX Basic pKa: ┄CX LogP: 4.90CX LogD: 4.68Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.32Np Likeness Score: -0.31
References 1. Mirguet O, Sautet S, Clément CA, Toum J, Donche F, Marques C, Rondet E, Pizzonero M, Beaufils B, Dudit Y, Huet P, Trottet L, Grondin P, Brusq JM, Boursier E, Saintillan Y, Nicodeme E.. (2013) Discovery of Pyridones As Oral AMPK Direct Activators., 4 (7): [PMID:24900722 ] [10.1021/ml400157g ]