The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
fimbricalyx A ID: ALA2409524
PubChem CID: 71623988
Max Phase: Preclinical
Molecular Formula: C36H34O7
Molecular Weight: 578.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC1=Cc2c(cc(OC3=C4C(=CC(=O)C4(C)C)c4cc(OC)c(C)cc4C3=O)c3cc(C)c(OC)cc23)C(C)(C)C1=O
Standard InChI: InChI=1S/C36H34O7/c1-17-10-22-19(12-26(17)40-7)21-14-29(42-9)34(39)35(3,4)25(21)16-28(22)43-33-31-23(15-30(37)36(31,5)6)20-13-27(41-8)18(2)11-24(20)32(33)38/h10-16H,1-9H3
Standard InChI Key: GOAXONQUIUAYOC-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
14.0778 -19.1270 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0590 -17.5034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0517 -16.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3376 -16.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6397 -16.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3582 -17.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6528 -17.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6683 -19.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3647 -18.7244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9584 -18.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9538 -17.9254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2540 -17.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5543 -17.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5589 -18.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2632 -19.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7549 -16.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3270 -15.4709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0293 -15.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8448 -17.5278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8413 -16.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8531 -19.1552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8584 -19.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8468 -19.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7816 -18.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7682 -17.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4686 -17.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1826 -17.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8848 -17.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8742 -16.6469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1554 -16.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4562 -16.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9500 -17.8915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1925 -18.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4948 -19.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6745 -19.9097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4834 -19.9835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8034 -19.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9016 -20.6856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8539 -19.9015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4565 -20.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1415 -15.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5757 -16.2278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2894 -16.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 7 1 0
6 7 1 0
7 11 2 0
10 8 2 0
8 9 1 0
9 6 2 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
3 16 1 0
4 17 1 0
17 18 1 0
9 1 1 0
13 19 1 0
19 20 1 0
14 21 2 0
15 22 1 0
15 23 1 0
1 24 1 0
24 34 2 0
33 27 1 0
26 25 1 0
25 24 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
25 32 2 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 33 2 0
36 38 2 0
35 39 1 0
35 40 1 0
30 41 1 0
29 42 1 0
42 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.66Molecular Weight (Monoisotopic): 578.2305AlogP: 6.84#Rotatable Bonds: 5Polar Surface Area: 88.13Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.84CX LogD: 6.84Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.33Np Likeness Score: 1.58
References 1. Seephonkai P, Pyne SG, Willis AC, Lie W.. (2013) Bioactive compounds from the roots of Strophioblachia fimbricalyx., 76 (7): [PMID:23806014 ] [10.1021/np400268d ]