The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-(methylsulfinylmethyl)tetrahydrofuran-3-yl 6-bromo-5-hydroxy-1H-indole-3-carboxylate ID: ALA2409549
PubChem CID: 71814323
Max Phase: Preclinical
Molecular Formula: C20H19BrN6O6S
Molecular Weight: 551.38
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[S+]([O-])C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OC(=O)c1c[nH]c2cc(Br)c(O)cc12
Standard InChI: InChI=1S/C20H19BrN6O6S/c1-34(31)5-13-16(33-20(30)9-4-23-11-3-10(21)12(28)2-8(9)11)15(29)19(32-13)27-7-26-14-17(22)24-6-25-18(14)27/h2-4,6-7,13,15-16,19,23,28-29H,5H2,1H3,(H2,22,24,25)/t13-,15-,16-,19-,34?/m1/s1
Standard InChI Key: YRDDCVZIQCURLZ-XODDSCPXSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
9.7518 -8.6604 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.4378 -6.9014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0900 -7.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2435 -6.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3359 -5.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5748 -5.5733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5067 -8.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0154 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2815 -7.8345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9536 -8.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1952 -8.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0895 -5.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9077 -7.2129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7538 -6.0596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6675 -6.8834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3426 -8.4689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1757 -4.7501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1284 -9.8146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4751 -9.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0363 -9.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7493 -7.8296 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5117 -10.3712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7213 -10.1155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6854 -11.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3568 -12.3469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4425 -11.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5444 -12.5206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1281 -11.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2995 -11.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8862 -12.5243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3076 -13.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1348 -13.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0555 -12.5280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8971 -13.9658 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 1
4 2 1 0
5 4 2 0
6 8 2 0
7 3 1 0
8 2 1 0
9 3 1 0
10 7 1 0
11 9 1 0
12 5 1 0
13 4 1 0
14 15 1 0
15 13 2 0
7 16 1 6
17 12 1 0
10 18 1 6
11 19 1 1
5 6 1 0
10 11 1 0
14 12 2 0
19 1 1 0
1 20 1 0
1 21 1 0
18 22 1 0
22 23 2 0
22 24 1 0
24 28 1 0
27 25 1 0
25 26 1 0
26 24 2 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
31 34 1 0
M CHG 2 1 1 21 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.38Molecular Weight (Monoisotopic): 550.0270AlogP: 1.22#Rotatable Bonds: 5Polar Surface Area: 184.46Molecular Species: NEUTRALHBA: 11HBD: 4#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.63CX Basic pKa: 3.94CX LogP: 0.23CX LogD: 0.03Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.21Np Likeness Score: 0.81
References 1. Li JL, Kim EL, Wang H, Hong J, Shin S, Lee CK, Jung JH.. (2013) Epimeric methylsulfinyladenosine derivatives from the marine ascidian Herdmania momus., 23 (16): [PMID:23810281 ] [10.1016/j.bmcl.2013.05.097 ] 2. Li JL, Kim EL, Wang H, Hong J, Shin S, Lee CK, Jung JH.. (2013) Epimeric methylsulfinyladenosine derivatives from the marine ascidian Herdmania momus., 23 (16): [PMID:23810281 ] [10.1016/j.bmcl.2013.05.097 ]