The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S,4R,5R)-5-(6-(4-(5-(dimethylamino)naphthalene-1-sulfonamido)butylamino)-9H-purin-9-yl)-N-ethyl-3,4-dimethyltetrahydrofuran-2-carboxamide ID: ALA2413104
PubChem CID: 73349100
Max Phase: Preclinical
Molecular Formula: C30H40N8O4S
Molecular Weight: 608.77
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCCCCNS(=O)(=O)c4cccc5c(N(C)C)cccc45)ncnc32)[C@H](C)[C@@H]1C
Standard InChI: InChI=1S/C30H40N8O4S/c1-6-31-29(39)26-19(2)20(3)30(42-26)38-18-35-25-27(33-17-34-28(25)38)32-15-7-8-16-36-43(40,41)24-14-10-11-21-22(24)12-9-13-23(21)37(4)5/h9-14,17-20,26,30,36H,6-8,15-16H2,1-5H3,(H,31,39)(H,32,33,34)/t19-,20+,26-,30+/m0/s1
Standard InChI Key: HGGBYEHYTYZPQS-SSFWPFINSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
7.8132 -9.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8132 -10.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5326 -10.7498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2479 -10.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2479 -9.5092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5326 -9.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0293 -9.2565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5408 -9.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0293 -10.5945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7724 -11.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9843 -11.6353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9843 -12.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7724 -12.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2567 -12.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0851 -12.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0293 -13.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3153 -12.9481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5615 -12.6108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4042 -13.7697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8925 -13.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1387 -12.7620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5326 -8.2686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2479 -7.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9614 -8.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6756 -7.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3890 -8.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1032 -7.8589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2247 -8.9835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8167 -8.2716 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.4042 -8.9809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5334 -7.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9578 -7.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5285 -7.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9567 -7.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2456 -8.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2446 -9.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9540 -9.5039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6658 -9.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6633 -8.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3763 -7.8602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2399 -6.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3747 -7.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0910 -8.2710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 2 0
8 9 1 0
9 2 1 0
10 9 1 1
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 10 1 0
14 15 1 6
13 16 1 6
12 17 1 1
17 18 1 0
17 19 2 0
18 20 1 0
20 21 1 0
6 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
29 28 2 0
30 29 2 0
29 31 1 0
31 35 2 0
34 32 2 0
32 41 1 0
33 31 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
39 40 1 0
33 41 2 0
40 42 1 0
40 43 1 0
27 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 608.77Molecular Weight (Monoisotopic): 608.2893AlogP: 3.52#Rotatable Bonds: 12Polar Surface Area: 143.37Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.91CX Basic pKa: 5.00CX LogP: 3.06CX LogD: 3.06Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.21Np Likeness Score: -0.85
References 1. Kozma E, Jayasekara PS, Squarcialupi L, Paoletta S, Moro S, Federico S, Spalluto G, Jacobson KA.. (2013) Fluorescent ligands for adenosine receptors., 23 (1): [PMID:23200243 ] [10.1016/j.bmcl.2012.10.112 ]