(E)-4-(2-(5-(4-Hydroxyphenyl)-1H-pyrazol-3-yl)vinyl)phenol

ID: ALA2413467

PubChem CID: 136244475

Max Phase: Preclinical

Molecular Formula: C17H14N2O2

Molecular Weight: 278.31

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1ccc(/C=C/c2cc(-c3ccc(O)cc3)[nH]n2)cc1

Standard InChI:  InChI=1S/C17H14N2O2/c20-15-7-2-12(3-8-15)1-6-14-11-17(19-18-14)13-4-9-16(21)10-5-13/h1-11,20-21H,(H,18,19)/b6-1+

Standard InChI Key:  ZPYKLGOBJUASGE-LZCJLJQNSA-N

Molfile:  

     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   20.8829  -29.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8817  -30.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5966  -31.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3130  -30.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3102  -29.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5948  -29.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0231  -29.3617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7392  -29.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4570  -29.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2359  -29.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7334  -28.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2611  -28.2984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.4719  -28.5386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.5583  -28.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9555  -29.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7796  -29.7288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2065  -29.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8032  -28.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9803  -28.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0314  -29.0362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1688  -31.0161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13  9  2  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
  2 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2413467

    ---

Associated Targets(Human)

MeWo (235 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 278.31Molecular Weight (Monoisotopic): 278.1055AlogP: 3.66#Rotatable Bonds: 3
Polar Surface Area: 69.14Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.91CX Basic pKa: 2.73CX LogP: 3.81CX LogD: 3.80
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.68Np Likeness Score: -0.32

References

1. Caldarelli A, Penucchini E, Caprioglio D, Genazzani AA, Minassi A..  (2013)  Synthesis and tubulin-binding properties of non-symmetrical click C5-curcuminoids.,  21  (17): [PMID:23830698] [10.1016/j.bmc.2013.05.053]

Source