(E)-4-(3-(4-Methoxystyryl)-1H-pyrazol-5-yl)phenol

ID: ALA2413468

PubChem CID: 136244568

Max Phase: Preclinical

Molecular Formula: C18H16N2O2

Molecular Weight: 292.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=C/c2cc(-c3ccc(O)cc3)[nH]n2)cc1

Standard InChI:  InChI=1S/C18H16N2O2/c1-22-17-10-3-13(4-11-17)2-7-15-12-18(20-19-15)14-5-8-16(21)9-6-14/h2-12,21H,1H3,(H,19,20)/b7-2+

Standard InChI Key:  GZPNQCDAKGCMRG-FARCUNLSSA-N

Molfile:  

     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   31.2769  -29.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2757  -30.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9906  -30.6228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7069  -30.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7041  -29.3789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9887  -28.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4170  -28.9637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1330  -29.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8509  -28.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6297  -29.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1271  -28.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6549  -27.9007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8657  -28.1408    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.9520  -28.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3491  -29.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1732  -29.3309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6000  -28.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1966  -27.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3739  -27.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4248  -28.6383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5629  -30.6180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5623  -31.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13  9  2  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 21 22  1  0
  2 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2413468

    ---

Associated Targets(Human)

MeWo (235 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 292.34Molecular Weight (Monoisotopic): 292.1212AlogP: 3.96#Rotatable Bonds: 4
Polar Surface Area: 58.14Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.84CX Basic pKa: 2.73CX LogP: 3.96CX LogD: 3.96
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.76Np Likeness Score: -0.37

References

1. Caldarelli A, Penucchini E, Caprioglio D, Genazzani AA, Minassi A..  (2013)  Synthesis and tubulin-binding properties of non-symmetrical click C5-curcuminoids.,  21  (17): [PMID:23830698] [10.1016/j.bmc.2013.05.053]

Source