5-[5-(4-Methoxyphenyl)-3-naphthalen-2-yl-4,5-dihydropyrazol-1-yl]-3-piperidin-1-ylmethylthiazolidine-2,4-dione

ID: ALA2414933

PubChem CID: 72205238

Max Phase: Preclinical

Molecular Formula: C29H30N4O3S

Molecular Weight: 514.65

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C2CC(c3ccc4ccccc4c3)=NN2C2SC(=O)N(CN3CCCCC3)C2=O)cc1

Standard InChI:  InChI=1S/C29H30N4O3S/c1-36-24-13-11-21(12-14-24)26-18-25(23-10-9-20-7-3-4-8-22(20)17-23)30-33(26)28-27(34)32(29(35)37-28)19-31-15-5-2-6-16-31/h3-4,7-14,17,26,28H,2,5-6,15-16,18-19H2,1H3

Standard InChI Key:  QJBPHQZAFKFRKI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
    6.0010   -4.1742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1760   -4.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9126   -4.9492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5778   -5.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2469   -4.9604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0294   -5.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745   -6.0087    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.0994   -6.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3614   -5.2319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6970   -4.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7026   -3.9175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5790   -6.6865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7747   -3.4465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2012   -2.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8006   -2.0229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9542   -3.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5513   -2.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9777   -2.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5738   -1.2862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7437   -1.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3191   -1.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7254   -2.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5722   -6.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8554   -6.6688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8493   -7.4930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5616   -7.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2811   -7.4992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2837   -6.6764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5569   -8.7361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8402   -9.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0738   -4.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7902   -5.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7900   -6.0472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5024   -6.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2172   -6.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2152   -5.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4982   -4.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  6  1  0
 10 11  2  0
  8 12  2  0
  2 13  1  0
 13 14  2  0
 14 15  1  0
 15 18  2  0
 17 16  2  0
 16 13  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  4 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
 29 30  1  0
  9 31  1  0
 31 32  1  0
 32 33  1  0
 32 37  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
M  END

Associated Targets(Human)

HOP-92 (41141 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 514.65Molecular Weight (Monoisotopic): 514.2039AlogP: 5.46#Rotatable Bonds: 6
Polar Surface Area: 65.45Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.11CX Basic pKa: 6.50CX LogP: 5.12CX LogD: 5.07
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -1.01

References

1. Havrylyuk D, Zimenkovsky B, Vasylenko O, Day CW, Smee DF, Grellier P, Lesyk R..  (2013)  Synthesis and biological activity evaluation of 5-pyrazoline substituted 4-thiazolidinones.,  66  [PMID:23811085] [10.1016/j.ejmech.2013.05.044]

Source