The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-Hydroxy-3-morpholinopropylthio)-6-phenyl-4-morpholinopyrimidine-5-carbonitrile ID: ALA2415032
PubChem CID: 45028927
Max Phase: Preclinical
Molecular Formula: C22H27N5O3S
Molecular Weight: 441.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1c(-c2ccccc2)nc(SCC(O)CN2CCOCC2)nc1N1CCOCC1
Standard InChI: InChI=1S/C22H27N5O3S/c23-14-19-20(17-4-2-1-3-5-17)24-22(25-21(19)27-8-12-30-13-9-27)31-16-18(28)15-26-6-10-29-11-7-26/h1-5,18,28H,6-13,15-16H2
Standard InChI Key: XVBPHNRNGMNJTB-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
5.3586 -5.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3586 -6.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0731 -7.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7876 -6.8235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7876 -5.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0731 -5.5860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 -7.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9297 -7.6485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 -5.5860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0731 -8.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5020 -5.5860 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.2165 -5.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9310 -5.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 -4.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9297 -4.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2152 -4.7610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2152 -5.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9297 -5.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9310 -4.7610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6454 -5.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3599 -5.5860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0744 -5.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7889 -5.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7889 -4.7610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0744 -4.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3599 -4.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3586 -8.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3586 -9.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0731 -9.7110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7876 -9.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7876 -8.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
2 7 1 0
7 8 3 0
1 9 1 0
3 10 1 0
5 11 1 0
11 12 1 0
12 13 1 0
9 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 9 1 0
13 19 1 0
13 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 21 1 0
10 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 10 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.56Molecular Weight (Monoisotopic): 441.1835AlogP: 1.64#Rotatable Bonds: 7Polar Surface Area: 94.74Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.45CX LogP: 2.64CX LogD: 2.59Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.73
References 1. Fargualy AM, Habib NS, Ismail KA, Hassan AM, Sarg MT.. (2013) Synthesis, biological evaluation and molecular docking studies of some pyrimidine derivatives., 66 [PMID:23811090 ] [10.1016/j.ejmech.2013.05.028 ]