The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-bromo-4-methoxybenzyl)-5-(3,5-dibromo-4-(2-(dimethylamino)ethoxy)phenyl)pyrazin-2(1H)-one ID: ALA2417778
PubChem CID: 72163594
Max Phase: Preclinical
Molecular Formula: C22H22Br3N3O3
Molecular Weight: 616.15
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2nc(-c3cc(Br)c(OCCN(C)C)c(Br)c3)c[nH]c2=O)cc1Br
Standard InChI: InChI=1S/C22H22Br3N3O3/c1-28(2)6-7-31-21-16(24)10-14(11-17(21)25)19-12-26-22(29)18(27-19)9-13-4-5-20(30-3)15(23)8-13/h4-5,8,10-12H,6-7,9H2,1-3H3,(H,26,29)
Standard InChI Key: AAUORFNJZIOJEL-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
15.8692 -7.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8692 -8.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5745 -8.4072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2798 -8.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2798 -7.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5745 -6.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9850 -6.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6918 -7.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4002 -6.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4031 -5.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6916 -5.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9861 -5.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1603 -6.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1579 -5.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8678 -5.5507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8657 -4.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1563 -4.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4474 -4.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4530 -5.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1621 -8.4123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1528 -3.5098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6911 -4.7418 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
20.1065 -7.1986 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
20.1114 -5.5621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8185 -5.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5268 -5.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2339 -5.9741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9423 -5.5666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2326 -6.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8588 -3.0982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5724 -4.3240 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
1 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
2 20 2 0
17 21 1 0
11 22 1 0
9 23 1 0
10 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
21 30 1 0
16 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.15Molecular Weight (Monoisotopic): 612.9211AlogP: 5.26#Rotatable Bonds: 8Polar Surface Area: 67.45Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.82CX Basic pKa: 8.63CX LogP: 4.82CX LogD: 3.56Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -0.43
References 1. Saha S, Reddy ChV, Xu S, Sankar S, Neamati N, Patro B.. (2013) Synthesis and SAR studies of marine natural products ma'edamines A, B and their analogues., 23 (18): [PMID:23927972 ] [10.1016/j.bmcl.2013.07.017 ]