The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-chloro-4-methoxybenzyl)-5-(3,5-dichloro-4-(3-(dimethylamino)propoxy)phenyl)pyrazin-2(1H)-one ID: ALA2417877
PubChem CID: 72163725
Max Phase: Preclinical
Molecular Formula: C23H24Cl3N3O3
Molecular Weight: 496.82
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2nc(-c3cc(Cl)c(OCCCN(C)C)c(Cl)c3)c[nH]c2=O)cc1Cl
Standard InChI: InChI=1S/C23H24Cl3N3O3/c1-29(2)7-4-8-32-22-17(25)11-15(12-18(22)26)20-13-27-23(30)19(28-20)10-14-5-6-21(31-3)16(24)9-14/h5-6,9,11-13H,4,7-8,10H2,1-3H3,(H,27,30)
Standard InChI Key: PSMJZABXJVIVAZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
17.4417 -7.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4417 -8.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1469 -8.5516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8522 -8.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8522 -7.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1469 -6.9172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5575 -6.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2643 -7.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9727 -6.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9755 -6.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2641 -5.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5585 -6.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7328 -6.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7304 -6.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4402 -5.6952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4382 -4.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7288 -4.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0199 -4.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0254 -5.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7346 -8.5568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7253 -3.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2636 -4.8863 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.6790 -7.3430 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.6839 -5.7065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3910 -6.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0993 -5.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8064 -6.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5147 -5.7110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2218 -6.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5160 -4.8939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0158 -3.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1449 -4.4684 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
1 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
2 20 2 0
17 21 1 0
11 22 1 0
9 23 1 0
10 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
21 31 1 0
16 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.82Molecular Weight (Monoisotopic): 495.0883AlogP: 5.33#Rotatable Bonds: 9Polar Surface Area: 67.45Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.82CX Basic pKa: 9.24CX LogP: 4.25CX LogD: 2.53Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -0.75
References 1. Saha S, Reddy ChV, Xu S, Sankar S, Neamati N, Patro B.. (2013) Synthesis and SAR studies of marine natural products ma'edamines A, B and their analogues., 23 (18): [PMID:23927972 ] [10.1016/j.bmcl.2013.07.017 ]