The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-methoxybenzyl)-5-(4-(3-morpholinopropoxy)phenyl)pyrazin-2(1H)-one ID: ALA2417883
PubChem CID: 72163843
Max Phase: Preclinical
Molecular Formula: C25H29N3O4
Molecular Weight: 435.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2nc(-c3ccc(OCCCN4CCOCC4)cc3)c[nH]c2=O)cc1
Standard InChI: InChI=1S/C25H29N3O4/c1-30-21-7-3-19(4-8-21)17-23-25(29)26-18-24(27-23)20-5-9-22(10-6-20)32-14-2-11-28-12-15-31-16-13-28/h3-10,18H,2,11-17H2,1H3,(H,26,29)
Standard InChI Key: FHUDXIRSVNXMPC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
24.6313 -20.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6313 -20.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3366 -21.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0419 -20.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0419 -20.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3366 -19.6208 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7471 -19.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4539 -20.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1623 -19.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1652 -18.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4537 -18.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7482 -18.8153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9224 -19.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9200 -18.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6299 -18.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6278 -17.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9184 -17.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2096 -17.5901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2151 -18.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9242 -21.2604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8735 -18.4101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5806 -18.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2889 -18.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9960 -18.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7044 -18.4147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4114 -18.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7057 -17.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4140 -17.1900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1198 -18.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1211 -17.5997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9149 -16.3578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6209 -15.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
1 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
2 20 2 0
10 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
27 28 1 0
28 30 1 0
26 29 1 0
29 30 1 0
17 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.52Molecular Weight (Monoisotopic): 435.2158AlogP: 3.14#Rotatable Bonds: 9Polar Surface Area: 76.68Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.81CX Basic pKa: 7.04CX LogP: 2.35CX LogD: 2.19Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: -1.01
References 1. Saha S, Reddy ChV, Xu S, Sankar S, Neamati N, Patro B.. (2013) Synthesis and SAR studies of marine natural products ma'edamines A, B and their analogues., 23 (18): [PMID:23927972 ] [10.1016/j.bmcl.2013.07.017 ]